Preferred Name |
didanosine |
|
Synonyms |
2',3'-dideoxyinosine Didanosine ddI 2,3-dideoxyinosine didanosine 9-((2R,5S)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-1,9-dihydro-purin-6-one 9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,9-dihydro-6H-purin-6-one dideoxyinosine 9-((2S,5R)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-9H-purin-6-ol DDI 9-((2R,5S)-5-(hydroxymethyl)-tetrahydrofuran-2-yl)-1H-purin-6(9H)-one didanosina ddIno didanosinum |
|
Definitions |
A purine 2',3'-dideoxyribonucleoside that is inosine in which the hydroxy groups at both the 2' and the 3' positions on the sugar moiety have been replaced by hydrogen. An antiviral drug, it is used as a medication to treat HIV/AIDS. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_490877 |
|
charge |
0 |
|
database_cross_reference |
Chemspider:45864 PMID:10386939 DrugBank:DB00900 KEGG:C06953 CAS:69655-05-6 Reaxys:3619529 PMID:1619614 Drug_Central:869 Beilstein:3619529 Wikipedia:Didanosine LINCS:LSM-6017 PMID:18549801 PMID:17046264 PDBeChem:2DI KEGG:D00296 PMID:7518199 PMID:29438107 Patent:EP206497 |
|
definition |
A purine 2',3'-dideoxyribonucleoside that is inosine in which the hydroxy groups at both the 2' and the 3' positions on the sugar moiety have been replaced by hydrogen. An antiviral drug, it is used as a medication to treat HIV/AIDS. |
|
formula |
C10H12N4O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_53756 http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_35221 |
|
has_alternative_id |
CHEBI:668806 CHEBI:39738 CHEBI:475381 CHEBI:4516 CHEBI:158219 |
|
has_exact_synonym |
2',3'-dideoxyinosine Didanosine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
ddI 2,3-dideoxyinosine didanosine 9-((2R,5S)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-1,9-dihydro-purin-6-one 9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,9-dihydro-6H-purin-6-one dideoxyinosine 9-((2S,5R)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-9H-purin-6-ol DDI 9-((2R,5S)-5-(hydroxymethyl)-tetrahydrofuran-2-yl)-1H-purin-6(9H)-one didanosina ddIno didanosinum |
|
id |
CHEBI:490877 |
|
in_subset | ||
inchi |
InChI=1S/C10H12N4O3/c15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16/h4-7,15H,1-3H2,(H,11,12,16)/t6-,7+/m0/s1 |
|
inchikey |
BXZVVICBKDXVGW-NKWVEPMBSA-N |
|
label |
didanosine |
|
mass |
236.22730 |
|
monoisotopicmass |
236.09094 |
|
notation |
CHEBI:490877 |
|
prefLabel |
didanosine |
|
smiles |
OC[C@@H]1CC[C@@H](O1)n1cnc2c1nc[nH]c2=O |
|
treeView | ||
subClassOf |