loading...| Preferred Name |
deferasirox |
|
| Synonyms |
4-[3,5-bis(2-hydroxyphenyl)-1H-1,2,4-triazol-1-yl]benzoic acid ICL 670A deferasiroxum deferasirox Exjade ICL 670 |
|
| Definitions |
A member of the class of triazoles, deferasirox is 1,2,4-triazole substituted by a 4-carboxyphenyl group at position 1 and by 2-hydroxyphenyl groups at positions 3 and 5. An orally active iron chelator, it is used to manage chronic iron overload in patients receiving long-term blood transfusions. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_49005 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D03669 DrugBank:DB01609 Beilstein:8442898 Reaxys:8442898 Drug_Central:3128 CAS:201530-41-8 |
|
| definition |
A member of the class of triazoles, deferasirox is 1,2,4-triazole substituted by a 4-carboxyphenyl group at position 1 and by 2-hydroxyphenyl groups at positions 3 and 5. An orally active iron chelator, it is used to manage chronic iron overload in patients receiving long-term blood transfusions. |
|
| formula |
C21H15N3O4 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
4-[3,5-bis(2-hydroxyphenyl)-1H-1,2,4-triazol-1-yl]benzoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ICL 670A deferasiroxum deferasirox Exjade ICL 670 |
|
| id |
CHEBI:49005 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H15N3O4/c25-17-7-3-1-5-15(17)19-22-20(16-6-2-4-8-18(16)26)24(23-19)14-11-9-13(10-12-14)21(27)28/h1-12,25-26H,(H,27,28) |
|
| inchikey |
BOFQWVMAQOTZIW-UHFFFAOYSA-N |
|
| label |
deferasirox |
|
| mass |
373.36162 |
|
| monoisotopicmass |
373.10626 |
|
| notation |
CHEBI:49005 |
|
| prefLabel |
deferasirox |
|
| smiles |
OC(=O)c1ccc(cc1)-n1nc(nc1-c1ccccc1O)-c1ccccc1O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_22723 http://purl.obolibrary.org/obo/CHEBI_33853 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22723 http://purl.obolibrary.org/obo/CHEBI_33853 |