loading...| Preferred Name |
estazolam |
|
| Synonyms |
8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine estazolam estazolamum 8-chloro-6-phenyl-4H-s-triazolo(4,3-a)(1,4)benzodiazepine |
|
| Definitions |
A triazolo[4,3-a][1,4]benzodiazepine having a phenyl group at position 6 and a chloro substituent at position 8. A short-acting benzodiazepine with general properties similar to diazepam, it is given by mouth as a hypnotic in the short-term management of insomnia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4858 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1220868 Patent:US3701782 Patent:DE2114441 DrugBank:DB01215 Wikipedia:Estazolam Patent:DE1955349 KEGG:D00311 CAS:29975-16-4 Patent:DE2012190 Drug_Central:1056 PMID:7154007 |
|
| definition |
A triazolo[4,3-a][1,4]benzodiazepine having a phenyl group at position 6 and a chloro substituent at position 8. A short-acting benzodiazepine with general properties similar to diazepam, it is given by mouth as a hypnotic in the short-term management of insomnia. |
|
| formula |
C16H11ClN4 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_50268 |
|
| has_alternative_id |
CHEBI:149847 |
|
| has_exact_synonym |
8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
estazolam estazolamum 8-chloro-6-phenyl-4H-s-triazolo(4,3-a)(1,4)benzodiazepine |
|
| id |
CHEBI:4858 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H11ClN4/c17-12-6-7-14-13(8-12)16(11-4-2-1-3-5-11)18-9-15-20-19-10-21(14)15/h1-8,10H,9H2 |
|
| inchikey |
CDCHDCWJMGXXRH-UHFFFAOYSA-N |
|
| label |
estazolam |
|
| mass |
294.73800 |
|
| monoisotopicmass |
294.06722 |
|
| notation |
CHEBI:4858 |
|
| prefLabel |
estazolam |
|
| smiles |
Clc1ccc-2c(c1)C(=NCc1nncn-21)c1ccccc1 |
|
| treeView | ||
| subClassOf |