Preferred Name |
phenylbutazone |
|
Synonyms |
Phenylbutazone 4-butyl-1,2-diphenylpyrazolidine-3,5-dione phenylbutazonum 3,5-Dioxo-1,2-diphenyl-4-n-butylpyrazolidine phenylbutazone Phenbutazone fenilbutazona 4-BUTYL-1,2-DIPHENYL-PYRAZOLIDINE-3,5-DIONE Phenylbutazon 4-n-Butyl-1,2-diphenyl-3,5-pyrazolidinedione |
|
Definitions |
A member of the class of pyrazolidines that is 1,2-diphenylpyrazolidine-3,5-dione carrying a butyl group at the 4-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_48574 |
|
charge |
0 |
|
database_cross_reference |
PMID:22180948 HMDB:HMDB0014950 DrugBank:DB00812 KEGG:D00510 PMID:21668837 Wikipedia:Phenylbutazone PDBeChem:P1Z PMID:22245664 PMID:19614844 PMID:25287371 Drug_Central:2145 PMID:23369749 PMID:12692637 PMID:11264893 PMID:3425858 PMID:26808199 PMID:26090772 Beilstein:290080 Reaxys:290080 PMID:23525812 PMID:7655439 CAS:50-33-9 VSDB:1775 LINCS:LSM-2219 PMID:13048452 PMID:20176071 PMID:13747451 KEGG:C07440 PMID:13010905 PMID:22082440 |
|
definition |
A member of the class of pyrazolidines that is 1,2-diphenylpyrazolidine-3,5-dione carrying a butyl group at the 4-position. |
|
formula |
C19H20N2O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_49110 http://purl.obolibrary.org/obo/CHEBI_73136 http://purl.obolibrary.org/obo/CHEBI_35475 http://purl.obolibrary.org/obo/CHEBI_25212 |
|
has_alternative_id |
CHEBI:8091 CHEBI:44635 |
|
has_exact_synonym |
Phenylbutazone 4-butyl-1,2-diphenylpyrazolidine-3,5-dione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
phenylbutazonum 3,5-Dioxo-1,2-diphenyl-4-n-butylpyrazolidine phenylbutazone Phenbutazone fenilbutazona 4-BUTYL-1,2-DIPHENYL-PYRAZOLIDINE-3,5-DIONE Phenylbutazon 4-n-Butyl-1,2-diphenyl-3,5-pyrazolidinedione |
|
id |
CHEBI:48574 |
|
in_subset | ||
inchi |
InChI=1S/C19H20N2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3 |
|
inchikey |
VYMDGNCVAMGZFE-UHFFFAOYSA-N |
|
label |
phenylbutazone |
|
mass |
308.37430 |
|
monoisotopicmass |
308.15248 |
|
notation |
CHEBI:48574 |
|
prefLabel |
phenylbutazone |
|
smiles |
CCCCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1 |
|
treeView | ||
subClassOf |