loading...| Preferred Name |
ciclopirox |
|
| Synonyms |
6-cyclohexyl-1-hydroxy-4-methylpyridin-2(1H)-one ciclopirox ciclopiroxum 6-cyclohexyl-1-hydroxy-4-methyl-2(1H)-pyridinone |
|
| Definitions |
A cyclic hydroxamic acid that is 1-hydroxypyridin-2(1H)-one in which the hydrogens at positions 4 and 6 are substituted by methyl and cyclohexyl groups, respectively. A broad spectrum antigfungal agent, it also exhibits antibacterial activity against many Gram-positive and Gram-negative bacteria, and has anti-inflammatory properties. It is used a a topical treatment of fungal skin and nail infections. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_453011 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:636 LINCS:LSM-5307 CAS:29342-05-0 KEGG:D03488 DrugBank:DB01188 Beilstein:1533423 PMID:16854048 PMID:17253868 Wikipedia:Ciclopirox Patent:US3883545 |
|
| definition |
A cyclic hydroxamic acid that is 1-hydroxypyridin-2(1H)-one in which the hydrogens at positions 4 and 6 are substituted by methyl and cyclohexyl groups, respectively. A broad spectrum antigfungal agent, it also exhibits antibacterial activity against many Gram-positive and Gram-negative bacteria, and has anti-inflammatory properties. It is used a a topical treatment of fungal skin and nail infections. |
|
| formula |
C12H17NO2 |
|
| has role | ||
| has_exact_synonym |
6-cyclohexyl-1-hydroxy-4-methylpyridin-2(1H)-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ciclopirox ciclopiroxum 6-cyclohexyl-1-hydroxy-4-methyl-2(1H)-pyridinone |
|
| id |
CHEBI:453011 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H17NO2/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10/h7-8,10,15H,2-6H2,1H3 |
|
| inchikey |
SCKYRAXSEDYPSA-UHFFFAOYSA-N |
|
| label |
ciclopirox |
|
| mass |
207.26890 |
|
| monoisotopicmass |
207.12593 |
|
| notation |
CHEBI:453011 |
|
| prefLabel |
ciclopirox |
|
| smiles |
Cc1cc(C2CCCCC2)n(O)c(=O)c1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_38183 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38183 |