loading...| Preferred Name |
diclofenac potassium |
|
| Synonyms |
potassium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate 2-((2,6-dichlorophenyl)amino)benzeneacetic acid, monopotassium salt Cataflam |
|
| Definitions |
The potassium salt of diclofenac. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4508 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:15307-81-0 PMID:1502708 KEGG:D00903 Beilstein:6625757 DrugBank:DB00586 |
|
| definition |
The potassium salt of diclofenac. |
|
| formula |
C14H10Cl2NO2.K C14H10Cl2KNO2 |
|
| has part | ||
| has_exact_synonym |
potassium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-((2,6-dichlorophenyl)amino)benzeneacetic acid, monopotassium salt Cataflam |
|
| id |
CHEBI:4508 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H11Cl2NO2.K/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;/h1-7,17H,8H2,(H,18,19);/q;+1/p-1 |
|
| inchikey |
KXZOIWWTXOCYKR-UHFFFAOYSA-M |
|
| label |
diclofenac potassium |
|
| mass |
334.23844 |
|
| monoisotopicmass |
332.97257 |
|
| notation |
CHEBI:4508 |
|
| prefLabel |
diclofenac potassium |
|
| smiles |
[K+].[O-]C(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
|
| treeView | ||
| subClassOf |