loading...| Preferred Name |
dezocine |
|
| Synonyms |
(5R,11S,13S)-13-amino-5-methyl-5,6,7,8,9,10,11,12-octahydro-5,11-methanobenzocyclodecen-3-ol Dezocine dezocine dezocina dezocinum (-)-13beta-amino-5,6,7,8,9,10,11alpha,12-octahydro-5alpha-methyl-5,11-methanobenzocyclodecen-3-ol |
|
| Definitions |
(7S,8S)-7-Amino-8-methyl-5,6,7,8-tetrahydronaphthalen-2-ol in which the hydrogen at position 8 and one of the hydrogens at position 6 are substituted by each end of a tetramethylene bridge. A synthetic opioid analgesic, it has mixed opiod agonist and antagonist properties. Although it is used for pain management, it can produce opioid withdrawal syndrome in patients already dependent on other opioids, and its clinical application is limited by side effects such as dizziness. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4474 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:847 DrugBank:DB01209 KEGG:C08010 Patent:DE2159324 Wikipedia:Dezocine KEGG:D00838 CAS:53648-55-8 Beilstein:3033759 |
|
| definition |
(7S,8S)-7-Amino-8-methyl-5,6,7,8-tetrahydronaphthalen-2-ol in which the hydrogen at position 8 and one of the hydrogens at position 6 are substituted by each end of a tetramethylene bridge. A synthetic opioid analgesic, it has mixed opiod agonist and antagonist properties. Although it is used for pain management, it can produce opioid withdrawal syndrome in patients already dependent on other opioids, and its clinical application is limited by side effects such as dizziness. |
|
| formula |
C16H23NO |
|
| has role | ||
| has_alternative_id |
CHEBI:618361 |
|
| has_exact_synonym |
(5R,11S,13S)-13-amino-5-methyl-5,6,7,8,9,10,11,12-octahydro-5,11-methanobenzocyclodecen-3-ol Dezocine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dezocine dezocina dezocinum (-)-13beta-amino-5,6,7,8,9,10,11alpha,12-octahydro-5alpha-methyl-5,11-methanobenzocyclodecen-3-ol |
|
| id |
CHEBI:4474 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H23NO/c1-16-8-4-2-3-5-12(15(16)17)9-11-6-7-13(18)10-14(11)16/h6-7,10,12,15,18H,2-5,8-9,17H2,1H3/t12-,15-,16+/m0/s1 |
|
| inchikey |
VTMVHDZWSFQSQP-VBNZEHGJSA-N |
|
| label |
dezocine |
|
| mass |
245.35990 |
|
| monoisotopicmass |
245.17796 |
|
| notation |
CHEBI:4474 |
|
| prefLabel |
dezocine |
|
| smiles |
[H][C@@]12CCCCC[C@@](C)([C@H]1N)c1cc(O)ccc1C2 |
|
| treeView | ||
| subClassOf |