loading...| Preferred Name |
dapsone |
|
| Synonyms |
DAPSONE Dapsone 4,4'-sulfonyldianiline 4-aminophenyl sulfone p,p-sulphonylbisbenzamine bis(4-aminophenyl)sulfone 4,4'-Sulfonylbisbenzenamine Bis(p-aminophenyl) sulfone p,p-sulphonylbisbenzenamine dapsone 4,4'-diaminodiphenyl sulfone 4-(4-aminophenylsulfonyl)aniline DIAPHENYLSULFONE p,p'-diaminodiphenyl sulfone 4-(4-aminophenylsulfonyl)benzenamine dapsonum DADPS 4-(4-amino-benzenesulfonyl)-phenylamine dapsona DDS 4,4'-sulfonylbisaniline 1,1'-sulfonylbis(4-aminobenzene) p-aminophenyl sulfone Diaphenylsulfone 4,4'-dapsone |
|
| Definitions |
A sulfone that is diphenylsulfone in which the hydrogen atom at the 4 position of each of the phenyl groups is substituted by an amino group. It is active against a wide range of bacteria, but is mainly employed for its actions against Mycobacterium leprae, being used as part of multidrug regimens in the treatment of all forms of leprosy. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4325 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:FR829926 PMID:28434260 LINCS:LSM-5714 PMID:28732451 KEGG:D00592 KEGG:C07666 PMID:29045131 PMID:18035772 Wikipedia:Dapsone Drug_Central:782 PMID:24232126 PMID:16361748 PMID:28699887 PMID:29280553 PMID:29192974 PMID:29233746 CAS:80-08-0 Reaxys:788055 PMID:24512442 Beilstein:788055 HMDB:HMDB0014395 PMID:29192999 DrugBank:DB00250 |
|
| definition |
A sulfone that is diphenylsulfone in which the hydrogen atom at the 4 position of each of the phenyl groups is substituted by an amino group. It is active against a wide range of bacteria, but is mainly employed for its actions against Mycobacterium leprae, being used as part of multidrug regimens in the treatment of all forms of leprosy. |
|
| formula |
C12H12N2O2S |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35441 http://purl.obolibrary.org/obo/CHEBI_35472 |
|
| has_alternative_id |
CHEBI:226356 |
|
| has_exact_synonym |
DAPSONE Dapsone 4,4'-sulfonyldianiline |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-aminophenyl sulfone p,p-sulphonylbisbenzamine bis(4-aminophenyl)sulfone 4,4'-Sulfonylbisbenzenamine Bis(p-aminophenyl) sulfone p,p-sulphonylbisbenzenamine dapsone 4,4'-diaminodiphenyl sulfone 4-(4-aminophenylsulfonyl)aniline DIAPHENYLSULFONE p,p'-diaminodiphenyl sulfone 4-(4-aminophenylsulfonyl)benzenamine dapsonum DADPS 4-(4-amino-benzenesulfonyl)-phenylamine dapsona DDS 4,4'-sulfonylbisaniline 1,1'-sulfonylbis(4-aminobenzene) p-aminophenyl sulfone Diaphenylsulfone 4,4'-dapsone |
|
| id |
CHEBI:4325 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H12N2O2S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8H,13-14H2 |
|
| inchikey |
MQJKPEGWNLWLTK-UHFFFAOYSA-N |
|
| label |
dapsone |
|
| mass |
248.30100 |
|
| monoisotopicmass |
248.06195 |
|
| notation |
CHEBI:4325 |
|
| prefLabel |
dapsone |
|
| smiles |
Nc1ccc(cc1)S(=O)(=O)c1ccc(N)cc1 |
|
| treeView | ||
| subClassOf |