Preferred Name |
sebacic acid |
|
Synonyms |
decanedioic acid SEBACIC ACID Sebacic acid Decanedioic acid 1,10-decanedioic acid 1,8-dicarboxyoctane Sebacinsaeure |
|
Definitions |
An alpha,omega-dicarboxylic acid that is the 1,8-dicarboxy derivative of octane. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_41865 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB07645 PMID:22770225 HMDB:HMDB0000792 Gmelin:102423 Beilstein:1210591 Reaxys:1210591 MetaCyc:CPD-3623 KEGG:C08277 Wikipedia:Sebacic_acid KNApSAcK:C00001202 PMID:9439441 CAS:111-20-6 LIPID_MAPS_instance:LMFA01170006 PDBeChem:DEC |
|
definition |
An alpha,omega-dicarboxylic acid that is the 1,8-dicarboxy derivative of octane. |
|
formula |
C10H18O4 |
|
has parent hydride | ||
has role | ||
has_alternative_id |
CHEBI:9071 CHEBI:41860 |
|
has_exact_synonym |
decanedioic acid SEBACIC ACID Sebacic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Decanedioic acid 1,10-decanedioic acid 1,8-dicarboxyoctane Sebacinsaeure |
|
id |
CHEBI:41865 |
|
in_subset | ||
inchi |
InChI=1S/C10H18O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-8H2,(H,11,12)(H,13,14) |
|
inchikey |
CXMXRPHRNRROMY-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
sebacic acid |
|
mass |
202.24752 |
|
monoisotopicmass |
202.12051 |
|
notation |
CHEBI:41865 |
|
prefLabel |
sebacic acid |
|
smiles |
OC(=O)CCCCCCCCC(O)=O |
|
treeView | ||
subClassOf |