loading...| Preferred Name |
benzophenone |
|
| Synonyms |
benzophenone Benzophenone diphenylmethanone benzoylbenzene alpha-oxoditane Ph2CO DIPHENYLMETHANONE alpha-oxodiphenylmethane Diphenyl ketone |
|
| Definitions |
The simplest member of the class of benzophenones, being formaldehyde in which both hydrogens are replaced by phenyl groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_41308 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23963450 Wikipedia:Benzophenone PMID:16820853 Gmelin:4256 PMID:16999485 PMID:17439666 Beilstein:1238185 PMID:32736220 PMID:30720459 PMID:19388040 Chemspider:2991 PMID:16853025 PMID:21277784 DrugBank:DB01878 HMDB:HMDB0032049 PMID:16212356 PMID:14673848 PDBeChem:BZQ PMID:25788150 CAS:119-61-9 PMID:15672204 Reaxys:1238185 PMID:26282042 PMID:20534002 PMID:10728861 PMID:19939518 PMID:21238557 KEGG:C06354 PMID:10877357 PMID:33682414 PMID:26254646 PMID:24226914 PMID:19655709 PMID:15373829 PMID:10864504 PMID:21919502 PMID:17955805 |
|
| definition |
The simplest member of the class of benzophenones, being formaldehyde in which both hydrogens are replaced by phenyl groups. |
|
| formula |
C13H10O |
|
| has role | ||
| has_alternative_id |
CHEBI:3034 CHEBI:41306 |
|
| has_exact_synonym |
benzophenone Benzophenone diphenylmethanone |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
benzoylbenzene alpha-oxoditane Ph2CO DIPHENYLMETHANONE alpha-oxodiphenylmethane Diphenyl ketone |
|
| id |
CHEBI:41308 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
|
| inchikey |
RWCCWEUUXYIKHB-UHFFFAOYSA-N |
|
| label |
benzophenone |
|
| mass |
182.222 |
|
| monoisotopicmass |
182.07316 |
|
| notation |
CHEBI:41308 |
|
| prefLabel |
benzophenone |
|
| smiles |
O=C(C1=CC=CC=C1)C1=CC=CC=C1 |
|
| treeView | ||
| subClassOf |