Preferred Name |
arformoterol |
|
Synonyms |
N-{2-hydroxy-5-[(1R)-1-hydroxy-2-{[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino}ethyl]phenyl}formamide (-)-formoterol (R,R)-formoterol arformoterol |
|
Definitions |
An N-[2-hydroxy-5-(1-hydroxy-2-{[1-(4-methoxyphenyl)propan-2-yl]amino}ethyl)phenyl]formamide in which both of the stereocentres have R configuration. The active enantiomer of formoterol, it is administered by inhalation (generally as the tartrate salt) as a direct-acting sympathomimetic and bronchodilator for the treatment of chronic obstructive pulmonary disease (any progressive respiratory disease that makes it harder to breathe over time, such as chronic bronchitis and emphysema). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_408174 |
|
charge |
0 |
|
database_cross_reference |
PMID:20214460 PMID:20406080 KEGG:D07463 PMID:15324892 PMID:18990965 CAS:67346-49-0 DrugBank:DB01274 Beilstein:7861827 Drug_Central:4943 Patent:US2011014246 |
|
definition |
An N-[2-hydroxy-5-(1-hydroxy-2-{[1-(4-methoxyphenyl)propan-2-yl]amino}ethyl)phenyl]formamide in which both of the stereocentres have R configuration. The active enantiomer of formoterol, it is administered by inhalation (generally as the tartrate salt) as a direct-acting sympathomimetic and bronchodilator for the treatment of chronic obstructive pulmonary disease (any progressive respiratory disease that makes it harder to breathe over time, such as chronic bronchitis and emphysema). |
|
formula |
C19H24N2O4 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35522 |
|
has_exact_synonym |
N-{2-hydroxy-5-[(1R)-1-hydroxy-2-{[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino}ethyl]phenyl}formamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(-)-formoterol (R,R)-formoterol arformoterol |
|
id |
CHEBI:408174 |
|
in_subset | ||
inchi |
InChI=1S/C19H24N2O4/c1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22/h3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22)/t13-,19+/m1/s1 |
|
inchikey |
BPZSYCZIITTYBL-YJYMSZOUSA-N |
|
is conjugate base of | ||
is enantiomer of | ||
label |
arformoterol |
|
mass |
344.40490 |
|
monoisotopicmass |
344.17361 |
|
notation |
CHEBI:408174 |
|
prefLabel |
arformoterol |
|
smiles |
[H]C(=O)Nc1cc(ccc1O)[C@@H](O)CN[C@H](C)Cc1ccc(OC)cc1 |
|
treeView | ||
subClassOf |