loading...| Preferred Name |
cytisine |
|
| Synonyms |
(1R,5S)-1,2,3,4,5,6-hexahydro-8H-1,5-methanopyrido[1,2-a][1,5]diazocin-8-one baptitoxine sophorine laburnin (-)-cytisine sophorin baptitoxin |
|
| Definitions |
An organic heterotricyclic compound that is the toxic principle in Laburnum seeds and is found in many members of the Fabaceae (legume, pea or bean) family. An acetylcholine agonist, it is widely used throughout Eastern Europe as an aid to giving up smoking. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4055 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23974638 PMID:21217866 PMID:25517706 PMID:23022271 PMID:25517710 PMID:24550234 PMID:24885253 PMID:23404838 PMID:25288485 Reaxys:83882 PMID:23601929 PMID:24831822 PMID:25117409 PMID:21991893 PMID:22090039 CAS:485-35-8 PMID:22367109 LINCS:LSM-25650 Wikipedia:Cytisine PMID:22250168 KNApSAcK:C00002218 KEGG:C10763 KEGG:D07770 PMID:23966067 PMID:24117010 PMID:23876236 PDBeChem:C5E PMID:23563038 PMID:25231024 |
|
| definition |
An organic heterotricyclic compound that is the toxic principle in Laburnum seeds and is found in many members of the Fabaceae (legume, pea or bean) family. An acetylcholine agonist, it is widely used throughout Eastern Europe as an aid to giving up smoking. |
|
| formula |
C11H14N2O |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_47958 |
|
| has_exact_synonym |
(1R,5S)-1,2,3,4,5,6-hexahydro-8H-1,5-methanopyrido[1,2-a][1,5]diazocin-8-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
baptitoxine sophorine laburnin (-)-cytisine sophorin baptitoxin |
|
| id |
CHEBI:4055 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2/t8-,9+/m0/s1 |
|
| inchikey |
ANJTVLIZGCUXLD-DTWKUNHWSA-N |
|
| label |
cytisine |
|
| mass |
190.24170 |
|
| monoisotopicmass |
190.11061 |
|
| notation |
CHEBI:4055 |
|
| prefLabel |
cytisine |
|
| smiles |
O=c1cccc2[C@H]3CNC[C@H](C3)Cn12 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_22315 http://purl.obolibrary.org/obo/CHEBI_50995 http://purl.obolibrary.org/obo/CHEBI_26979 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22315 http://purl.obolibrary.org/obo/CHEBI_50995 http://purl.obolibrary.org/obo/CHEBI_26979 |