Preferred Name |
cyclopentolate |
|
Synonyms |
Cyclopentolate 2-(dimethylamino)ethyl (1-hydroxycyclopentyl)(phenyl)acetate 2-(dimethylamino)ethyl 1-hydroxy-alpha-phenylcyclopentaneacetate cyclopentolatum alpha-(1-hydroxycyclopentyl)benzeneacetic acid 2-(dimethylamino)ethyl ester cyclopentolate (+-)-cyclopentolate ciclopentolato 2-phenyl-2-(1-hydroxycyclopentyl)ethanoic acid beta-(dimethylamino)ethyl ester 2-(dimethylamino)ethyl 2-(1-hydroxycyclopentyl)-2-phenylacetate beta-dimethylaminoethyl (1-hydroxycyclopentyl)phenylacetate 1-hydroxy-alpha-phenylcyclopentaneacetic acid 2-(dimethylamino)ethyl ester beta-(dimethylamino)ethyl (1-hydroxycyclopentyl)phenylacetate |
|
Definitions |
A carboxylic ester resulting from the formal condensation of (1-hydroxycyclopentyl)(phenyl)acetic acid with N,N-dimethylethanolamine. A tertiary amine antimuscarinic with actions similar to atropine, it is used as its hydrochloride salt to produce mydriasis (excessive dilation of the pupil) and cycloplegia (paralysis of the ciliary muscle of the eye) for opthalmic diagnostic procedures. It acts more quickly than atropine and has a shorter duration of action. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4024 |
|
charge |
0 |
|
database_cross_reference |
HMDB:HMDB0015114 Patent:US2554511 LINCS:LSM-1800 Wikipedia:Cyclopentolate Drug_Central:757 CAS:512-15-2 Reaxys:2147087 KEGG:D07759 DrugBank:DB00979 KEGG:C06932 Beilstein:2147087 |
|
definition |
A carboxylic ester resulting from the formal condensation of (1-hydroxycyclopentyl)(phenyl)acetic acid with N,N-dimethylethanolamine. A tertiary amine antimuscarinic with actions similar to atropine, it is used as its hydrochloride salt to produce mydriasis (excessive dilation of the pupil) and cycloplegia (paralysis of the ciliary muscle of the eye) for opthalmic diagnostic procedures. It acts more quickly than atropine and has a shorter duration of action. |
|
formula |
C17H25NO3 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_33295 http://purl.obolibrary.org/obo/CHEBI_50513 |
|
has_exact_synonym |
Cyclopentolate 2-(dimethylamino)ethyl (1-hydroxycyclopentyl)(phenyl)acetate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-(dimethylamino)ethyl 1-hydroxy-alpha-phenylcyclopentaneacetate cyclopentolatum alpha-(1-hydroxycyclopentyl)benzeneacetic acid 2-(dimethylamino)ethyl ester cyclopentolate (+-)-cyclopentolate ciclopentolato 2-phenyl-2-(1-hydroxycyclopentyl)ethanoic acid beta-(dimethylamino)ethyl ester 2-(dimethylamino)ethyl 2-(1-hydroxycyclopentyl)-2-phenylacetate beta-dimethylaminoethyl (1-hydroxycyclopentyl)phenylacetate 1-hydroxy-alpha-phenylcyclopentaneacetic acid 2-(dimethylamino)ethyl ester beta-(dimethylamino)ethyl (1-hydroxycyclopentyl)phenylacetate |
|
id |
CHEBI:4024 |
|
in_subset | ||
inchi |
InChI=1S/C17H25NO3/c1-18(2)12-13-21-16(19)15(14-8-4-3-5-9-14)17(20)10-6-7-11-17/h3-5,8-9,15,20H,6-7,10-13H2,1-2H3 |
|
inchikey |
SKYSRIRYMSLOIN-UHFFFAOYSA-N |
|
label |
cyclopentolate |
|
mass |
291.38530 |
|
monoisotopicmass |
291.18344 |
|
notation |
CHEBI:4024 |
|
prefLabel |
cyclopentolate |
|
smiles |
CN(C)CCOC(=O)C(c1ccccc1)C1(O)CCCC1 |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_33308 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33308 |