Preferred Name |
cyclobenzaprine |
|
Synonyms |
Cyclobenzaprine 3-(5H-dibenzo[a,d][7]annulen-5-ylidene)-N,N-dimethylpropan-1-amine 3-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethylpropan-1-amine cyclobenzaprine (3-Dibenzo[a,d]cyclohepten-5-ylidene-propyl)-dimethyl-amine N,N-dimethyl-5H-dibenzo(a,d)cycloheptene-Delta(5,gamma)-propylamine ciclobenzaprina cyclobenzaprinum |
|
Definitions |
5-Methylidene-5H-dibenzo[a,d]cycloheptene in which one of the hydrogens of the methylidene group is substituted by a 2-(dimethylamino)ethyl group. A centrally acting skeletal muscle relaxant, it is used as its hydrochloride salt in the symptomatic treatment of painful muscle spasm. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3996 |
|
charge |
0 |
|
database_cross_reference |
PMID:18027916 KEGG:D07758 Patent:GB858187 DrugBank:DB00924 Wikipedia:Cyclobenzaprine Beilstein:2126383 Drug_Central:751 KEGG:C06931 LINCS:LSM-5537 PMID:17725338 CAS:303-53-7 |
|
definition |
5-Methylidene-5H-dibenzo[a,d]cycloheptene in which one of the hydrogens of the methylidene group is substituted by a 2-(dimethylamino)ethyl group. A centrally acting skeletal muscle relaxant, it is used as its hydrochloride salt in the symptomatic treatment of painful muscle spasm. |
|
formula |
C20H21N |
|
has parent hydride | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_51371 |
|
has_alternative_id |
CHEBI:128119 |
|
has_exact_synonym |
Cyclobenzaprine 3-(5H-dibenzo[a,d][7]annulen-5-ylidene)-N,N-dimethylpropan-1-amine 3-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethylpropan-1-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
cyclobenzaprine (3-Dibenzo[a,d]cyclohepten-5-ylidene-propyl)-dimethyl-amine N,N-dimethyl-5H-dibenzo(a,d)cycloheptene-Delta(5,gamma)-propylamine ciclobenzaprina cyclobenzaprinum |
|
id |
CHEBI:3996 |
|
in_subset | ||
inchi |
InChI=1S/C20H21N/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20/h3-6,8-14H,7,15H2,1-2H3 |
|
inchikey |
JURKNVYFZMSNLP-UHFFFAOYSA-N |
|
label |
cyclobenzaprine |
|
mass |
275.38740 |
|
monoisotopicmass |
275.16740 |
|
notation |
CHEBI:3996 |
|
prefLabel |
cyclobenzaprine |
|
smiles |
CN(C)CCC=C1c2ccccc2C=Cc2ccccc12 |
|
treeView | ||
subClassOf |