Preferred Name |
oleanolic acid |
|
Synonyms |
3beta-hydroxyolean-12-en-28-oic acid Virgaureagenin B 3beta-Hydroxyolean-12-en-28-oic acid Giganteumgenin C Astrantiagenin C Caryophyllin Oleanic acid |
|
Definitions |
A pentacyclic triterpenoid that is olean-12-en-28-oic acid substituted by a beta-hydroxy group at position 3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_37659 |
|
charge |
0 |
|
database_cross_reference |
PMID:15541359 KEGG:C17148 PMID:24393202 CAS:508-02-1 Wikipedia:Oleanolic_acid |
|
definition |
A pentacyclic triterpenoid that is olean-12-en-28-oic acid substituted by a beta-hydroxy group at position 3. |
|
formula |
C30H48O3 |
|
has parent hydride | ||
has role | ||
has_exact_synonym |
3beta-hydroxyolean-12-en-28-oic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Virgaureagenin B 3beta-Hydroxyolean-12-en-28-oic acid Giganteumgenin C Astrantiagenin C Caryophyllin Oleanic acid |
|
id |
CHEBI:37659 |
|
in_subset | ||
inchi |
InChI=1S/C30H48O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8,20-23,31H,9-18H2,1-7H3,(H,32,33)/t20-,21-,22+,23-,27-,28+,29+,30-/m0/s1 |
|
inchikey |
MIJYXULNPSFWEK-GTOFXWBISA-N |
|
is conjugate acid of | ||
label |
oleanolic acid |
|
mass |
456.70030 |
|
monoisotopicmass |
456.36035 |
|
notation |
CHEBI:37659 |
|
prefLabel |
oleanolic acid |
|
smiles |
[H][C@@]12CC(C)(C)CC[C@@]1(CC[C@]1(C)C2=CC[C@]2([H])[C@@]3(C)CC[C@H](O)C(C)(C)[C@]3([H])CC[C@@]12C)C(O)=O |
|
treeView | ||
subClassOf |