Preferred Name |
clonazepam |
|
Synonyms |
CLONAZEPAM 5-(2-chlorophenyl)-7-nitro-1,3-dihydro-2H-1,4-benzodiazepin-2-one clonazepam 1,3-dihydro-7-nitro-5-(2-chlorophenyl)-2H-1,4.benzodiazepin-2-one 5-(o-chlorophenyl)-7-nitro-1,3-dihydro-2H-1,4-benzodiazepin-2-one clonazepamum 5-(2-Chloro-phenyl)-7-nitro-1,3-dihydro-benzo[e][1,4]diazepin-2-one 5-(2-chlorophenyl)-7-nitro-1H-benzo[e][1,4]diazepin-2(3H)-one |
|
Definitions |
1,3-Dihydro-2H-1,4-benzodiazepin-2-one in which the hydrogens at positions 5 and 7 are substituted by 2-chlorophenyl and nitro groups, respectively. It is used in the treatment of all types of epilepsy and seizures, as well as myoclonus and associated abnormal movements, and panic disorders. However, its use can be limited by the development of tolerance and by sedation. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3756 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:703 Patent:US3335181 PMID:12873507 Patent:US3116203 KEGG:D00280 Patent:US3121076 PMID:12213069 CAS:1622-61-3 PMID:10633040 Beilstein:759557 Wikipedia:Clonazepam DrugBank:DB01068 |
|
definition |
1,3-Dihydro-2H-1,4-benzodiazepin-2-one in which the hydrogens at positions 5 and 7 are substituted by 2-chlorophenyl and nitro groups, respectively. It is used in the treatment of all types of epilepsy and seizures, as well as myoclonus and associated abnormal movements, and panic disorders. However, its use can be limited by the development of tolerance and by sedation. |
|
formula |
C15H10ClN3O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50268 |
|
has_alternative_id |
CHEBI:102465 |
|
has_exact_synonym |
CLONAZEPAM 5-(2-chlorophenyl)-7-nitro-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
clonazepam 1,3-dihydro-7-nitro-5-(2-chlorophenyl)-2H-1,4.benzodiazepin-2-one 5-(o-chlorophenyl)-7-nitro-1,3-dihydro-2H-1,4-benzodiazepin-2-one clonazepamum 5-(2-Chloro-phenyl)-7-nitro-1,3-dihydro-benzo[e][1,4]diazepin-2-one 5-(2-chlorophenyl)-7-nitro-1H-benzo[e][1,4]diazepin-2(3H)-one |
|
id |
CHEBI:3756 |
|
in_subset | ||
inchi |
InChI=1S/C15H10ClN3O3/c16-12-4-2-1-3-10(12)15-11-7-9(19(21)22)5-6-13(11)18-14(20)8-17-15/h1-7H,8H2,(H,18,20) |
|
inchikey |
DGBIGWXXNGSACT-UHFFFAOYSA-N |
|
label |
clonazepam |
|
mass |
315.71100 |
|
monoisotopicmass |
315.04107 |
|
notation |
CHEBI:3756 |
|
prefLabel |
clonazepam |
|
smiles |
[O-][N+](=O)c1ccc2NC(=O)CN=C(c3ccccc3Cl)c2c1 |
|
treeView | ||
subClassOf |