Preferred Name |
clofibrate |
|
Synonyms |
Clofibrate ethyl 2-(4-chlorophenoxy)-2-methylpropanoate 2-(p-Chlorophenoxy)-2-methylpropionic acid ethyl ester Ethyl 2-(p-chlorophenoxy)isobutyrate clofibrate Atromid-S clofibrato Lipofacton Ethyl chlorophenoxyisobutyrate 2-(4-Chlorophenoxy)-2-methylpropanoic acid ethyl ester ELPI alpha-(p-Chlorophenoxy)isobutyric acid, ethyl ester Ethyl clofibrate EPIB clofibratum alpha-p-Chlorophenoxyisobutyryl ethyl ester Liprin |
|
Definitions |
The ethyl ester of clofibric acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3750 |
|
charge |
0 |
|
database_cross_reference |
PMID:33893992 KEGG:C06916 LINCS:LSM-2996 PMID:28779283 Wikipedia:Clofibrate PMID:26949064 Beilstein:1913459 KEGG:D00279 PMID:23603800 PMID:28248971 PMID:30642049 HMDB:HMDB0014774 PMID:28512725 Drug_Central:694 PMID:28485676 PMCID:PMC7258001 Patent:US3262850 PMID:29059162 CAS:637-07-0 Patent:GB860303 PMCID:PMC8265473 PMID:27354598 DrugBank:DB00636 Chemspider:2694 PMID:33070841 |
|
definition |
The ethyl ester of clofibric acid. |
|
formula |
C12H15ClO3 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_70782 http://purl.obolibrary.org/obo/CHEBI_35679 |
|
has_exact_synonym |
Clofibrate ethyl 2-(4-chlorophenoxy)-2-methylpropanoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-(p-Chlorophenoxy)-2-methylpropionic acid ethyl ester Ethyl 2-(p-chlorophenoxy)isobutyrate clofibrate Atromid-S clofibrato Lipofacton Ethyl chlorophenoxyisobutyrate 2-(4-Chlorophenoxy)-2-methylpropanoic acid ethyl ester ELPI alpha-(p-Chlorophenoxy)isobutyric acid, ethyl ester Ethyl clofibrate EPIB clofibratum alpha-p-Chlorophenoxyisobutyryl ethyl ester Liprin |
|
id |
CHEBI:3750 |
|
in_subset | ||
inchi |
InChI=1S/C12H15ClO3/c1-4-15-11(14)12(2,3)16-10-7-5-9(13)6-8-10/h5-8H,4H2,1-3H3 |
|
inchikey |
KNHUKKLJHYUCFP-UHFFFAOYSA-N |
|
label |
clofibrate |
|
mass |
242.69900 |
|
monoisotopicmass |
242.07097 |
|
notation |
CHEBI:3750 |
|
prefLabel |
clofibrate |
|
smiles |
CCOC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_35618 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |