Preferred Name |
imiquimod |
|
Synonyms |
Imiquimod 1-(2-methylpropyl)-1H-imidazo[4,5-c]quinolin-4-amine 4-Amino-1-isobutyl-1H-imidazo(4,5-c)quinoline 1-isobutyl-1H-imidazo[4,5-c]quinolin-4-amine imiquimod R 837 imiquimodum |
|
Definitions |
An imidazoquinoline fused [4,5-c] carrying isobutyl and amino substituents at N-1 and C-4 respectively. A prescription medication, it acts as an immune response modifier and is used to treat genital warts, superficial basal cell carcinoma, and actinic keratosis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_36704 |
|
charge |
0 |
|
database_cross_reference |
PMID:18424373 Wikipedia:Imiquimod Beilstein:7710060 PMID:27548435 PMID:10861101 DrugBank:DB00724 Patent:KR20070102652 PMID:15868314 PMID:29422777 Patent:AU2005320890 PMID:29485187 PMID:16217984 Reaxys:7710060 PMID:29505317 PMID:28872561 LINCS:LSM-5408 PMID:29596875 Patent:EP1831219 CAS:99011-02-6 Drug_Central:1429 |
|
definition |
An imidazoquinoline fused [4,5-c] carrying isobutyl and amino substituents at N-1 and C-4 respectively. A prescription medication, it acts as an immune response modifier and is used to treat genital warts, superficial basal cell carcinoma, and actinic keratosis. |
|
formula |
C14H16N4 |
|
has role | ||
has_exact_synonym |
Imiquimod 1-(2-methylpropyl)-1H-imidazo[4,5-c]quinolin-4-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4-Amino-1-isobutyl-1H-imidazo(4,5-c)quinoline 1-isobutyl-1H-imidazo[4,5-c]quinolin-4-amine imiquimod R 837 imiquimodum |
|
id |
CHEBI:36704 |
|
in_subset | ||
inchi |
InChI=1S/C14H16N4/c1-9(2)7-18-8-16-12-13(18)10-5-3-4-6-11(10)17-14(12)15/h3-6,8-9H,7H2,1-2H3,(H2,15,17) |
|
inchikey |
DOUYETYNHWVLEO-UHFFFAOYSA-N |
|
label |
imiquimod |
|
mass |
240.304 |
|
monoisotopicmass |
240.13750 |
|
notation |
CHEBI:36704 |
|
prefLabel |
imiquimod |
|
smiles |
C1=2C=CC=CC2N=C(C=3N=CN(C13)CC(C)C)N |
|
treeView | ||
subClassOf |