Jump to:
loading...| Preferred Name |
phosphorous acid |
|
| Synonyms |
trioxophosphoric(3-) acid trihydrogen trioxophosphate(3-) trihydroxidophosphorus phosphorous acid phosphorige Saeure P(OH)3 H3PO3 phosphite [P(OH)3] |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_36361 |
|
| charge |
0 |
|
| database_cross_reference |
Gmelin:164068 CAS:10294-56-1 |
|
| formula |
H3O3P |
|
| has_alternative_id |
CHEBI:29196 CHEBI:26081 |
|
| has_exact_synonym |
trioxophosphoric(3-) acid trihydrogen trioxophosphate(3-) trihydroxidophosphorus phosphorous acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
phosphorige Saeure P(OH)3 H3PO3 phosphite [P(OH)3] |
|
| id |
CHEBI:36361 |
|
| in_subset | ||
| inchi |
InChI=1S/H3O3P/c1-4(2)3/h1-3H |
|
| inchikey |
OJMIONKXNSYLSR-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is tautomer of | ||
| label |
phosphorous acid |
|
| mass |
81.99578 |
|
| monoisotopicmass |
81.98198 |
|
| notation |
CHEBI:36361 |
|
| prefLabel |
phosphorous acid |
|
| smiles |
[H]OP(O[H])O[H] |
|
| treeView | ||
| subClassOf |
Create mapping