loading...| Preferred Name |
caffeic acid |
|
| Synonyms |
3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
|
| Definitions |
A hydroxycinnamic acid that is cinnamic acid in which the phenyl ring is substituted by hydroxy groups at positions 3 and 4. It exists in cis and trans forms; the latter is the more common. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_36281 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:15778121 PMID:18061431 PMID:18482095 Beilstein:2210883 PMID:8340025 Reaxys:2210883 KEGG:C01481 PMID:11373473 HMDB:HMDB0001964 LINCS:LSM-5272 PMID:18314336 PMID:20542693 |
|
| definition |
A hydroxycinnamic acid that is cinnamic acid in which the phenyl ring is substituted by hydroxy groups at positions 3 and 4. It exists in cis and trans forms; the latter is the more common. |
|
| formula |
C9H8O4 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_64964 http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_76797 http://purl.obolibrary.org/obo/CHEBI_22586 |
|
| has_exact_synonym |
3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:36281 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13) |
|
| inchikey |
QAIPRVGONGVQAS-UHFFFAOYSA-N |
|
| label |
caffeic acid |
|
| mass |
180.15740 |
|
| monoisotopicmass |
180.04226 |
|
| notation |
CHEBI:36281 |
|
| prefLabel |
caffeic acid |
|
| smiles |
OC(=O)C=Cc1ccc(O)c(O)c1 |
|
| treeView | ||
| subClassOf |