loading...| Preferred Name |
diflubenzuron |
|
| Synonyms |
N-[(4-chlorophenyl)carbamoyl]-2,6-difluorobenzamide Diflubenzuron 1-(p-chlorophenyl)-3-(2,6-difluorobenzoyl)urea N-(4-Chlorophenylcarbamoyl)-2,6-difluorobenzamide difluron N-{[(4-chlorophenyl)amino]carbonyl}-2,6-difluorobenzamide 1-(4-chlorophenyl)-3-(2,6-difluorobenzoyl)urea |
|
| Definitions |
A benzoylurea insecticide that is urea in which a hydrogen attached to one of the nitrogens is replaced by a 4-chlorophenyl group, and a hydrogen attached to the other nitrogen is replaced bgy a 2,6-difluorobenzoyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34703 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:20954045 PPDB:234 Wikipedia:Diflubenzuron PMID:8510122 CAS:35367-38-5 Beilstein:2162461 KEGG:C14427 PMID:22782793 HMDB:HMDB0031778 PMID:19835689 KEGG:D07829 |
|
| definition |
A benzoylurea insecticide that is urea in which a hydrogen attached to one of the nitrogens is replaced by a 4-chlorophenyl group, and a hydrogen attached to the other nitrogen is replaced bgy a 2,6-difluorobenzoyl group. |
|
| formula |
C14H9ClF2N2O2 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
N-[(4-chlorophenyl)carbamoyl]-2,6-difluorobenzamide Diflubenzuron |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-(p-chlorophenyl)-3-(2,6-difluorobenzoyl)urea N-(4-Chlorophenylcarbamoyl)-2,6-difluorobenzamide difluron N-{[(4-chlorophenyl)amino]carbonyl}-2,6-difluorobenzamide 1-(4-chlorophenyl)-3-(2,6-difluorobenzoyl)urea |
|
| id |
CHEBI:34703 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H9ClF2N2O2/c15-8-4-6-9(7-5-8)18-14(21)19-13(20)12-10(16)2-1-3-11(12)17/h1-7H,(H2,18,19,20,21) |
|
| inchikey |
QQQYTWIFVNKMRW-UHFFFAOYSA-N |
|
| label |
diflubenzuron |
|
| mass |
310.68305 |
|
| monoisotopicmass |
310.03206 |
|
| notation |
CHEBI:34703 |
|
| prefLabel |
diflubenzuron |
|
| smiles |
Fc1cccc(F)c1C(=O)NC(=O)Nc1ccc(Cl)cc1 |
|
| treeView | ||
| subClassOf |