loading...| Preferred Name |
pyruvic acid |
|
| Synonyms |
2-oxopropanoic acid pyruvic acid PYRUVIC ACID Pyruvic acid Acetylformic acid 2-Oxopropionsaeure 2-ketopropionic acid 2-Oxopropanoic acid CH3COCOOH alpha-ketopropionic acid acide pyruvique acetylformic acid Pyroracemic acid 2-Oxopropansaeure Brenztraubensaeure BTS alpha-Oxopropionsaeure |
|
| Definitions |
A 2-oxo monocarboxylic acid that is the 2-keto derivative of propionic acid. It is a metabolite obtained during glycolysis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_32816 |
|
| charge |
0 |
|
| database_cross_reference |
HMDB:HMDB0000243 Wikipedia:Pyruvic_acid PMID:22770225 YMDB:YMDB00175 PDBeChem:PYR KEGG:C00022 Gmelin:101087 Beilstein:506211 LIPID_MAPS_instance:LMFA01060077 CAS:127-17-3 KNApSAcK:C00001200 PMID:22150460 MetaCyc:PYRUVATE PMID:22735334 PMID:11762589 ECMDB:ECMDB00243 DrugBank:DB00119 Reaxys:506211 PMID:22233273 PMID:19260671 |
|
| definition |
A 2-oxo monocarboxylic acid that is the 2-keto derivative of propionic acid. It is a metabolite obtained during glycolysis. |
|
| formula |
C3H4O3 |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:45253 CHEBI:26466 CHEBI:8685 |
|
| has_exact_synonym |
2-oxopropanoic acid pyruvic acid PYRUVIC ACID Pyruvic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Acetylformic acid 2-Oxopropionsaeure 2-ketopropionic acid 2-oxopropanoic acid 2-Oxopropanoic acid CH3COCOOH alpha-ketopropionic acid acide pyruvique acetylformic acid Pyroracemic acid 2-Oxopropansaeure Brenztraubensaeure BTS alpha-Oxopropionsaeure |
|
| id |
CHEBI:32816 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6) |
|
| inchikey |
LCTONWCANYUPML-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
pyruvic acid |
|
| mass |
88.06206 |
|
| monoisotopicmass |
88.01604 |
|
| notation |
CHEBI:32816 |
|
| prefLabel |
pyruvic acid |
|
| smiles |
CC(=O)C(O)=O |
|
| treeView | ||
| subClassOf |