loading...| Preferred Name |
butorphanol |
|
| Synonyms |
BUTORPHANOL Butorphanol 17-(cyclobutylmethyl)morphinan-3,14-diol butorfanol butorphanol (-)-17-(cyclobutylmethyl)morphinan-3,14-diol (-)-N-cyclobutylmethyl-3,14-dihydroxymorphinan butorphanolum (-)-butorphanol |
|
| Definitions |
Levorphanol in which a hydrogen at position 14 of the morphinan skeleton is substituted by hydroxy and one of the hydrogens of the N-methyl group is substituted by cyclopropyl. A semi-synthetic opioid agonist-antagonist analgesic, it is used as its (S,S)-tartaric acid salt for relief or moderate to severe pain. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3242 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00611 PMID:6767032 PMID:7192744 Drug_Central:454 Patent:US3775414 Beilstein:8134188 PMID:6166748 Patent:US3819635 Patent:DE2243961 Wikipedia:Butorphanol KEGG:C06863 VSDB:1780 KEGG:D03197 PMID:6114178 CAS:42408-82-2 PMID:6796691 |
|
| definition |
Levorphanol in which a hydrogen at position 14 of the morphinan skeleton is substituted by hydroxy and one of the hydrogens of the N-methyl group is substituted by cyclopropyl. A semi-synthetic opioid agonist-antagonist analgesic, it is used as its (S,S)-tartaric acid salt for relief or moderate to severe pain. |
|
| formula |
C21H29NO2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_55322 http://purl.obolibrary.org/obo/CHEBI_59282 |
|
| has_alternative_id |
CHEBI:145838 |
|
| has_exact_synonym |
BUTORPHANOL Butorphanol 17-(cyclobutylmethyl)morphinan-3,14-diol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
butorfanol butorphanol (-)-17-(cyclobutylmethyl)morphinan-3,14-diol (-)-N-cyclobutylmethyl-3,14-dihydroxymorphinan butorphanolum (-)-butorphanol |
|
| id |
CHEBI:3242 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H29NO2/c23-17-7-6-16-12-19-21(24)9-2-1-8-20(21,18(16)13-17)10-11-22(19)14-15-4-3-5-15/h6-7,13,15,19,23-24H,1-5,8-12,14H2/t19-,20+,21-/m1/s1 |
|
| inchikey |
IFKLAQQSCNILHL-QHAWAJNXSA-N |
|
| label |
butorphanol |
|
| mass |
327.46050 |
|
| monoisotopicmass |
327.21983 |
|
| notation |
CHEBI:3242 |
|
| prefLabel |
butorphanol |
|
| smiles |
Oc1ccc2C[C@H]3N(CC[C@@]4(CCCC[C@@]34O)c2c1)CC1CCC1 |
|
| treeView | ||
| subClassOf |