loading...| Preferred Name |
fluorescein (lactone form) |
|
| Synonyms |
3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one Japan Yellow 201 9-(o-carboxyphenyl)-6-hydroxy-3H-xanthen-3-one 9-(o-carboxyphenyl)-6-hydroxy-3-isoxanthenone 3',6'-dihydroxyfluoran Fluoreszein fluorescein lactone Yellow fluorescein Solvent Yellow 94 resorcinolphthalein D and C Yellow No. 7 3,6-fluorandiol C.I. 45350 fluoresceine D&C Yellow No. 7 C.I. Solvent Yellow 94 |
|
| Definitions |
A xanthene dye that is highly fluorescent, detectable even when present in minute quantities. Used forensically to detect traces of blood, in analytical chemistry as an indicator in silver nitrate titrations and in microscopy. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31624 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:28781922 PMID:8341496 PMID:26744790 PMID:27303817 PMID:8637844 PDB:4FAB PMID:33838945 PMID:7868912 PMID:12945055 PMID:16307475 PMID:24709799 PMID:31620443 PMID:15465055 PMID:33661250 PMID:23737658 PMID:26457839 PMID:7873555 PMID:28490862 PMID:29065823 Reaxys:94324 PMID:24756415 PMID:26756394 PMID:15178254 PMID:21443768 Gmelin:248626 CAS:2321-07-5 DrugBank:DB00693 PMID:1854691 HMDB:HMDB0014831 PMID:20725378 PMID:13611166 PMID:3937554 PMID:17076510 PMID:15836438 PMID:27833927 PMID:29237120 PMID:20371259 PMID:16195545 PMID:15352064 PMID:2104617 PMID:2508085 Chemspider:15968 PMID:17097086 PMID:30772364 PMID:23363235 PMID:26675489 PMID:8030782 Wikipedia:Fluorescein PMID:9294871 PMID:6192565 PMID:1517825 PMID:19603796 PMID:24614144 KEGG:D01261 Beilstein:94324 PMID:7696460 |
|
| definition |
A xanthene dye that is highly fluorescent, detectable even when present in minute quantities. Used forensically to detect traces of blood, in analytical chemistry as an indicator in silver nitrate titrations and in microscopy. |
|
| formula |
C20H12O5 |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:606590 |
|
| has_exact_synonym |
3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Japan Yellow 201 9-(o-carboxyphenyl)-6-hydroxy-3H-xanthen-3-one 9-(o-carboxyphenyl)-6-hydroxy-3-isoxanthenone 3',6'-dihydroxyfluoran Fluoreszein fluorescein lactone Yellow fluorescein Solvent Yellow 94 resorcinolphthalein D and C Yellow No. 7 3,6-fluorandiol C.I. 45350 fluoresceine D&C Yellow No. 7 C.I. Solvent Yellow 94 |
|
| id |
CHEBI:31624 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H12O5/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20/h1-10,21-22H |
|
| inchikey |
GNBHRKFJIUUOQI-UHFFFAOYSA-N |
|
| label |
fluorescein (lactone form) |
|
| mass |
332.311 |
|
| monoisotopicmass |
332.06847 |
|
| notation |
CHEBI:31624 |
|
| prefLabel |
fluorescein (lactone form) |
|
| smiles |
OC1=CC=C2C(OC3=CC(O)=CC=C3C22OC(=O)C3=C2C=CC=C3)=C1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_37929 http://purl.obolibrary.org/obo/CHEBI_38831 http://purl.obolibrary.org/obo/CHEBI_38164 http://purl.obolibrary.org/obo/CHEBI_37948 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_37929 http://purl.obolibrary.org/obo/CHEBI_38831 http://purl.obolibrary.org/obo/CHEBI_38164 http://purl.obolibrary.org/obo/CHEBI_37948 |