loading...| Preferred Name |
benzphetamine |
|
| Synonyms |
(2S)-N-benzyl-N-methyl-1-phenylpropan-2-amine Benzphetamine d-N-methyl-N-benzyl-beta-phenylisopropylamine Benzfetamine (S)-(+)-N-benzyl-N,alpha-dimethylphenethylamine benzaphetamine (+)-N-benzyl-N,alpha-dimethylphenethylamine benzfetamine benzylamphetamine (S)-benzphetamine (S)-(+)-benzphetamine (+)-benzphetamine (alphaS)-N,alpha-dimethylphenethylamine benzfetaminum N-methyl-1-phenyl-N-(phenylmethyl)propan-2-amine (+)-N,alpha-dimethyl-N-(phenylmethyl)-benzeneethanamine benzfetamina |
|
| Definitions |
Dextroamphetamine in which the the hydrogens attached to the amino group are substituted by a methyl and a benzyl group. A sympathomimetic agent with properties similar to dextroamphetamine, it is used as its hydrochloride salt in the treatment of obesity. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3044 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00865 Drug_Central:329 KEGG:C07538 Beilstein:3203999 Patent:US2789138 CAS:156-08-1 KEGG:D07514 |
|
| definition |
Dextroamphetamine in which the the hydrogens attached to the amino group are substituted by a methyl and a benzyl group. A sympathomimetic agent with properties similar to dextroamphetamine, it is used as its hydrochloride salt in the treatment of obesity. |
|
| formula |
C17H21N |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_51039 http://purl.obolibrary.org/obo/CHEBI_35524 |
|
| has_exact_synonym |
(2S)-N-benzyl-N-methyl-1-phenylpropan-2-amine Benzphetamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
d-N-methyl-N-benzyl-beta-phenylisopropylamine Benzfetamine (S)-(+)-N-benzyl-N,alpha-dimethylphenethylamine benzaphetamine (+)-N-benzyl-N,alpha-dimethylphenethylamine benzfetamine benzylamphetamine (S)-benzphetamine (S)-(+)-benzphetamine (+)-benzphetamine (alphaS)-N,alpha-dimethylphenethylamine benzfetaminum N-methyl-1-phenyl-N-(phenylmethyl)propan-2-amine (+)-N,alpha-dimethyl-N-(phenylmethyl)-benzeneethanamine benzfetamina |
|
| id |
CHEBI:3044 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H21N/c1-15(13-16-9-5-3-6-10-16)18(2)14-17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3/t15-/m0/s1 |
|
| inchikey |
YXKTVDFXDRQTKV-HNNXBMFYSA-N |
|
| label |
benzphetamine |
|
| mass |
239.35530 |
|
| monoisotopicmass |
239.16740 |
|
| notation |
CHEBI:3044 |
|
| prefLabel |
benzphetamine |
|
| smiles |
C[C@@H](Cc1ccccc1)N(C)Cc1ccccc1 |
|
| treeView | ||
| subClassOf |