loading...| Preferred Name |
fosfomycin |
|
| Synonyms |
[(2R,3S)-3-methyloxiran-2-yl]phosphonic acid FOSFOMYCIN L-cis-1,2-epoxypropylphosphonic acid (-)-(1R,2S)-(1,2-Epoxypropyl)phosphonic acid fosfomycinum phosphonemycin Phosphomycin (2R-cis)-(3-Methyloxiranyl)phosphonic acid (1R,2S)-epoxypropylphosphonic acid 1R-cis-(1,2-epoxypropyl)phosphonic acid fosfomycin cis-(1R,2S)-epoxypropylphosphonic acid fosfomycine fosfomicina FCM Phosphonomycin |
|
| Definitions |
A phosphonic acid having an (R,S)-1,2-epoxypropyl group attached to phosphorus. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28915 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:3900889 PMID:2660079 PDBeChem:FCN PMID:6796449 KEGG:C06454 MetaCyc:CPD0-1113 CAS:23155-02-4 PMID:488578 PMID:740308 PMID:7224844 Drug_Central:1243 PMID:288976 PMID:9309262 DrugBank:DB00828 Reaxys:1680831 PMID:19308743 KNApSAcK:C00000789 PMID:7030849 PMID:614140 PMID:17124631 KEGG:D04253 PMID:105327 PMID:3464490 PMID:6348659 |
|
| definition |
A phosphonic acid having an (R,S)-1,2-epoxypropyl group attached to phosphorus. |
|
| formula |
C3H7O4P |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:24100 CHEBI:42503 CHEBI:8159 |
|
| has_exact_synonym |
[(2R,3S)-3-methyloxiran-2-yl]phosphonic acid FOSFOMYCIN |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
L-cis-1,2-epoxypropylphosphonic acid (-)-(1R,2S)-(1,2-Epoxypropyl)phosphonic acid fosfomycinum phosphonemycin Phosphomycin (2R-cis)-(3-Methyloxiranyl)phosphonic acid (1R,2S)-epoxypropylphosphonic acid 1R-cis-(1,2-epoxypropyl)phosphonic acid fosfomycin cis-(1R,2S)-epoxypropylphosphonic acid fosfomycine fosfomicina FCM Phosphonomycin |
|
| id |
CHEBI:28915 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H7O4P/c1-2-3(7-2)8(4,5)6/h2-3H,1H3,(H2,4,5,6)/t2-,3+/m0/s1 |
|
| inchikey |
YMDXZJFXQJVXBF-STHAYSLISA-N |
|
| is conjugate acid of | ||
| label |
fosfomycin |
|
| mass |
138.05900 |
|
| monoisotopicmass |
138.00820 |
|
| notation |
CHEBI:28915 |
|
| prefLabel |
fosfomycin |
|
| smiles |
C[C@@H]1O[C@@H]1P(O)(O)=O |
|
| treeView | ||
| subClassOf |