Preferred Name |
genistein |
|
Synonyms |
5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one Genistein GENISTEIN 4',5,7-trihydroxyisoflavone 5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one Sophoricol 5,7,4'-Trihydroxyisoflavone Prunetol |
|
Definitions |
A 7-hydroxyisoflavone with additional hydroxy groups at positions 5 and 4'. It is a phytoestrogenic isoflavone with antioxidant properties. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28088 |
|
charge |
0 |
|
database_cross_reference |
FooDB:FDB011828 PMID:11564287 PMID:24023812 LINCS:LSM-5549 PMID:10912792 MetaCyc:CPD-3141 PMID:28166217 PMID:24379139 PMID:10741415 PMID:24297371 DrugBank:DB01645 PMID:26322379 KEGG:D11680 PMID:19402570 KNApSAcK:C00002526 CAS:446-72-0 Wikipedia:Genistein PMID:19107852 Chemspider:4444448 PMID:15576033 PMID:25593647 PMID:14654166 HMDB:HMDB0003217 PMID:15196699 PMID:18490856 PMID:12629420 PMID:18413741 PMID:18815740 PMID:34314575 Beilstein:263823 PMID:17979711 PMID:15833883 PMID:28259640 LIPID_MAPS_instance:LMPK12050218 PMID:15853412 PMID:16061678 PMID:22303062 PMID:18344977 KEGG:C06563 PMID:17004897 PMID:15772566 PMID:10469641 PMID:15288519 PMID:20211733 PMID:16166295 Reaxys:263823 PDBeChem:GEN |
|
definition |
A 7-hydroxyisoflavone with additional hydroxy groups at positions 5 and 4'. It is a phytoestrogenic isoflavone with antioxidant properties. |
|
formula |
C15H10O5 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_38637 http://purl.obolibrary.org/obo/CHEBI_84087 http://purl.obolibrary.org/obo/CHEBI_176497 |
|
has_alternative_id |
CHEBI:5302 CHEBI:42763 CHEBI:24204 |
|
has_exact_synonym |
5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one Genistein GENISTEIN |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4',5,7-trihydroxyisoflavone 5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one Sophoricol 5,7,4'-Trihydroxyisoflavone Prunetol |
|
id |
CHEBI:28088 |
|
in_subset | ||
inchi |
InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H |
|
inchikey |
TZBJGXHYKVUXJN-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
genistein |
|
mass |
270.240 |
|
monoisotopicmass |
270.05282 |
|
notation |
CHEBI:28088 |
|
prefLabel |
genistein |
|
smiles |
OC1=CC=C(C=C1)C1=COC2=C(C(O)=CC(O)=C2)C1=O |
|
treeView | ||
subClassOf |