loading...| Preferred Name |
resorcinol |
|
| Synonyms |
resorcinol Resorcinol benzene-1,3-diol RESORCINOL Resorzin 1,3-Benzenediol m-Hydroquinone m-hydroxyphenol Resorcin 1,3-Dihydroxybenzene 1,3-Dihydroxybenzol |
|
| Definitions |
A benzenediol that is benzene dihydroxylated at positions 1 and 3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27810 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23352755 CAS:108-46-3 HMDB:HMDB0032037 MetaCyc:CPD-623 Reaxys:906905 PMID:29079364 PMID:3263257 KNApSAcK:C00002671 KEGG:C01751 PMID:11792395 PMID:24269627 PDBeChem:RCO Gmelin:26734 UM-BBD_compID:c0265 Beilstein:906905 KEGG:D00133 Wikipedia:Resorcinol Drug_Central:3524 |
|
| definition |
A benzenediol that is benzene dihydroxylated at positions 1 and 3. |
|
| formula |
C6H6O2 |
|
| has role | ||
| has_alternative_id |
CHEBI:8812 CHEBI:26532 CHEBI:45349 |
|
| has_exact_synonym |
resorcinol Resorcinol benzene-1,3-diol RESORCINOL |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Resorzin 1,3-Benzenediol m-Hydroquinone m-hydroxyphenol Resorcin 1,3-Dihydroxybenzene 1,3-Dihydroxybenzol |
|
| id |
CHEBI:27810 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H6O2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
|
| inchikey |
GHMLBKRAJCXXBS-UHFFFAOYSA-N |
|
| label |
resorcinol |
|
| mass |
110.11064 |
|
| monoisotopicmass |
110.03678 |
|
| notation |
CHEBI:27810 |
|
| prefLabel |
resorcinol |
|
| smiles |
Oc1cccc(O)c1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_17701 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_17701 |