loading...| Preferred Name |
heroin |
|
| Synonyms |
Heroin 17-methyl-7,8-didehydro-4,5alpha-epoxymorphinan-3,6alpha-diyl diacetate Diacetylmorphine 3,6-Diacetylmorphine Diamorphine O,O'-Diacetylmorphine (5alpha,6alpha)-7,8-Didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol diacetate (ester) 7,8-Dihydro-4,5-alpha-epoxy-17-methylmorphinan-3,6-alpha-diol diacetate |
|
| Definitions |
A morphinane alkaloid that is morphine bearing two acetyl substituents on the O-3 and O-6 positions. As with other opioids, heroin is used as both an analgesic and a recreational drug. Frequent and regular administration is associated with tolerance and physical dependence, which may develop into addiction. Its use includes treatment for acute pain, such as in severe physical trauma, myocardial infarction, post-surgical pain, and chronic pain, including end-stage cancer and other terminal illnesses. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27808 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:12965116 PMID:15843500 PMID:21235340 PMID:10454516 PMID:11441925 PMID:21734607 PMID:21608377 PMID:15550572 CAS:561-27-3 PMID:20810225 PMID:15772255 PMID:20735218 PMID:20331562 Reaxys:99261 PMID:15213301 PMID:14534521 DrugBank:DB01452 PMID:15212982 PMID:20649590 PMID:21452028 Drug_Central:4412 PMID:21568984 PMID:21309955 PMID:16076083 PMID:8893832 PMID:21527184 PMID:11557911 PMID:21740578 PMID:11448454 KEGG:C06534 PMID:2352148 PMID:21362452 Wikipedia:Heroin KEGG:D07286 PMID:20855171 PMID:16333714 PMID:8858977 PMID:9918543 |
|
| definition |
A morphinane alkaloid that is morphine bearing two acetyl substituents on the O-3 and O-6 positions. As with other opioids, heroin is used as both an analgesic and a recreational drug. Frequent and regular administration is associated with tolerance and physical dependence, which may develop into addiction. Its use includes treatment for acute pain, such as in severe physical trauma, myocardial infarction, post-surgical pain, and chronic pain, including end-stage cancer and other terminal illnesses. |
|
| formula |
C21H23NO5 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_55322 |
|
| has_alternative_id |
CHEBI:5680 CHEBI:24528 |
|
| has_exact_synonym |
Heroin 17-methyl-7,8-didehydro-4,5alpha-epoxymorphinan-3,6alpha-diyl diacetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Diacetylmorphine 3,6-Diacetylmorphine Diamorphine O,O'-Diacetylmorphine (5alpha,6alpha)-7,8-Didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol diacetate (ester) 7,8-Dihydro-4,5-alpha-epoxy-17-methylmorphinan-3,6-alpha-diol diacetate |
|
| id |
CHEBI:27808 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H23NO5/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20/h4-7,14-15,17,20H,8-10H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1 |
|
| inchikey |
GVGLGOZIDCSQPN-PVHGPHFFSA-N |
|
| label |
heroin |
|
| mass |
369.41100 |
|
| monoisotopicmass |
369.15762 |
|
| notation |
CHEBI:27808 |
|
| prefLabel |
heroin |
|
| smiles |
[H][C@]12C=C[C@H](OC(C)=O)[C@@H]3Oc4c(OC(C)=O)ccc5C[C@H]1N(C)CC[C@@]23c45 |
|
| treeView | ||
| subClassOf |