loading...| Preferred Name |
ethyl acetate |
|
| Synonyms |
ethyl acetate Ethyl acetate ETHYL ACETATE 1-acetoxyethane ethyl ethanoate CH3-CO-O-CH3 ethyl acetic ester Ethylacetat acetoxyethane Ethylazetat vinegar naphtha acetic ester AcOEt Essigester Acetyl ester Essigsaeureethylester acetic acid ethyl ester acetic acid, ethyl ester EtOAc |
|
| Definitions |
The acetate ester formed between acetic acid and ethanol. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27750 |
|
| charge |
0 |
|
| database_cross_reference |
UM-BBD_compID:c0036 PMID:21764274 CAS:141-78-6 KEGG:D02319 PMID:15497757 Beilstein:506104 PMID:23078109 PMID:21797203 KEGG:C00849 Wikipedia:Ethyl_acetate Reaxys:506104 Gmelin:26306 HMDB:HMDB0031217 PMID:23108979 PDBeChem:EEE KEGG:C01883 PMID:23351147 KNApSAcK:C00001308 PMID:23614288 PMID:23089728 PMID:11684179 |
|
| definition |
The acetate ester formed between acetic acid and ethanol. |
|
| formula |
C4H8O2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_77706 http://purl.obolibrary.org/obo/CHEBI_75772 |
|
| has_alternative_id |
CHEBI:23989 CHEBI:2389 CHEBI:42244 |
|
| has_exact_synonym |
ethyl acetate Ethyl acetate ETHYL ACETATE |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-acetoxyethane ethyl ethanoate CH3-CO-O-CH3 ethyl acetic ester Ethylacetat acetoxyethane Ethylazetat vinegar naphtha acetic ester AcOEt Essigester Acetyl ester Essigsaeureethylester acetic acid ethyl ester acetic acid, ethyl ester EtOAc |
|
| id |
CHEBI:27750 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
|
| inchikey |
XEKOWRVHYACXOJ-UHFFFAOYSA-N |
|
| label |
ethyl acetate |
|
| mass |
88.10512 |
|
| monoisotopicmass |
88.05243 |
|
| notation |
CHEBI:27750 |
|
| prefLabel |
ethyl acetate |
|
| smiles |
CCOC(C)=O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_134179 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_134179 |