loading...| Preferred Name |
amobarbital |
|
| Synonyms |
5-ethyl-5-(3-methylbutyl)pyrimidine-2,4,6(1H,3H,5H)-trione Amobarbital amytal 5-ethyl-5-isoamylbarbituric acid barbamyl amylobarbitone 5-ethyl-5-(3-methylbutyl)-2,4,6(1H,3H,5H)-pyrimidinetrione 5-ethyl-5-(3-methylbutyl)barbituric acid 5-ethyl-5-isopentylbarbituric acid barbamil |
|
| Definitions |
A member of the class of barbiturates that is pyrimidine-2,4,6(1H,3H,5H)-trione substituted by a 3-methylbutyl and an ethyl group at position 5. Amobarbital has been shown to exhibit sedative and hypnotic properties. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2673 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Amobarbital Gmelin:281708 Beilstein:211172 Drug_Central:184 KEGG:D00555 CAS:57-43-2 Patent:US3507960 MetaCyc:CPD-5742 HMDB:HMDB0015440 Reaxys:211172 KEGG:C07536 DrugBank:DB01351 |
|
| definition |
A member of the class of barbiturates that is pyrimidine-2,4,6(1H,3H,5H)-trione substituted by a 3-methylbutyl and an ethyl group at position 5. Amobarbital has been shown to exhibit sedative and hypnotic properties. |
|
| formula |
C11H18N2O3 |
|
| has_exact_synonym |
5-ethyl-5-(3-methylbutyl)pyrimidine-2,4,6(1H,3H,5H)-trione Amobarbital |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
amytal 5-ethyl-5-isoamylbarbituric acid barbamyl amylobarbitone 5-ethyl-5-(3-methylbutyl)-2,4,6(1H,3H,5H)-pyrimidinetrione 5-ethyl-5-(3-methylbutyl)barbituric acid 5-ethyl-5-isopentylbarbituric acid barbamil |
|
| id |
CHEBI:2673 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H18N2O3/c1-4-11(6-5-7(2)3)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16) |
|
| inchikey |
VIROVYVQCGLCII-UHFFFAOYSA-N |
|
| label |
amobarbital |
|
| mass |
226.27230 |
|
| monoisotopicmass |
226.13174 |
|
| notation |
CHEBI:2673 |
|
| prefLabel |
amobarbital |
|
| smiles |
CCC1(CCC(C)C)C(=O)NC(=O)NC1=O |
|
| treeView | ||
| subClassOf |