loading...| Preferred Name |
aminophylline |
|
| Synonyms |
1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - ethane-1,2-diamine (2:1) Aminophylline theophyline ethylenediamine Euphyllin Peterphyllin Rectalad aminophylline Diuxanthine Metaphyllin Vasofilina 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compd with 1,2-ethanediamine (2:1) Variaphylline Eufilina Stenovasan Euphyllinum Euphylline Etilen-Xantisan Diaphylline Cariomin Phyllocontin Theophylline ethylenediamine aminophyllinum TAD aminofilina Theodrox Ethophylline Theolamine theophylline, compd with ethylenediamine (2:1) aminophylline Theophyldine Aminophyllin Metaphylline TH/100 Carena Aminodur Genophyllin Theophyllin aethylendiamin Eurphyllin Euufilin Somophyllin Cardophylin Miofilin Diophllin Theophyllaminium Diaphilline ethylenediamine, compd. with theophylline (1:2) Cardiomin Theomin Aminocardol Theophyllamine Aminodur dura-tabs Lasodex Thephyldine Syntophyllin Truphylline Neophyiline Theophyline ethylenediamine Cardiofilina BY 108 Grifomin Phylcardin Neophylline Aminofillina Diophyllin Theophyllaminum Lixaminol Phyllindon Tefamin Minaphil Dobo Cardophyllin Euufillin Linampheta Methophylline Inophylline Theolone Norofilina |
|
| Definitions |
A mixture comprising of theophylline and ethylenediamine in a 2:1 ratio. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2659 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:2636295 CAS:317-34-0 PMID:21223510 PMID:17391155 KEGG:D00227 PMID:18568240 DrugBank:DB01223 PMID:30797981 PMID:14608279 PMID:12615581 Wikipedia:Aminophylline PMID:20206069 PMID:10654755 PMID:31122698 |
|
| definition |
A mixture comprising of theophylline and ethylenediamine in a 2:1 ratio. |
|
| formula |
C7H8N4O2.C7H8N4O2.C2H8N2 |
|
| has part | ||
| has role | ||
| has_exact_synonym |
1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - ethane-1,2-diamine (2:1) Aminophylline |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
theophyline ethylenediamine Euphyllin Peterphyllin Rectalad aminophylline Diuxanthine Metaphyllin Vasofilina 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compd with 1,2-ethanediamine (2:1) Variaphylline Eufilina Stenovasan Euphyllinum Euphylline Etilen-Xantisan Diaphylline Cariomin Phyllocontin Theophylline ethylenediamine aminophyllinum TAD aminofilina Theodrox Ethophylline Theolamine theophylline, compd with ethylenediamine (2:1) aminophylline Theophyldine Aminophyllin Metaphylline TH/100 Carena Aminodur Genophyllin Theophyllin aethylendiamin Eurphyllin Euufilin Somophyllin Cardophylin Miofilin Diophllin Theophyllaminium Diaphilline ethylenediamine, compd. with theophylline (1:2) Cardiomin Theomin Aminocardol Theophyllamine Aminodur dura-tabs Lasodex Thephyldine Syntophyllin Truphylline Neophyiline Theophyline ethylenediamine Cardiofilina BY 108 Grifomin Phylcardin Neophylline Aminofillina Diophyllin Theophyllaminum Lixaminol Phyllindon Tefamin Minaphil Dobo Cardophyllin Euufillin Linampheta Methophylline Inophylline Theolone Norofilina |
|
| id |
CHEBI:2659 |
|
| in_subset | ||
| inchi |
InChI=1S/2C7H8N4O2.C2H8N2/c2*1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h2*3H,1-2H3,(H,8,9);1-4H2 |
|
| inchikey |
FQPFAHBPWDRTLU-UHFFFAOYSA-N |
|
| label |
aminophylline |
|
| mass |
420.434 |
|
| monoisotopicmass |
420.19820 |
|
| notation |
CHEBI:2659 |
|
| prefLabel |
aminophylline |
|
| smiles |
NCCN.CN1C2=C(NC=N2)C(=O)N(C)C1=O.CN1C2=C(NC=N2)C(=O)N(C)C1=O |
|
| treeView | ||
| subClassOf |