loading...| Preferred Name |
amantadine hydrochloride |
|
| Synonyms |
Amantadine hydrochloride adamantan-1-aminium chloride 1-Aminoadamantene hydrochlorid 1-Adamantanamine hydrochloride tricyclo[3.3.1.1(3,7)]decan-1-aminium chloride 1-Aminoadamantane hydrochloride Symmetrel 1-Adamantylamine hydrochloride |
|
| Definitions |
A hydrochloride obtained by combining amantadine and hydrochloric acid in equimolar amounts. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2619 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D00777 Gmelin:838463 DrugBank:DB00915 KEGG:C07939 Wikipedia:Amantadine PMID:24695262 PMID:16170253 PMID:24263176 Beilstein:4198854 PMID:20020057 CAS:665-66-7 PMID:24614731 PMID:11054856 Reaxys:4198854 |
|
| definition |
A hydrochloride obtained by combining amantadine and hydrochloric acid in equimolar amounts. |
|
| formula |
C10H17N.HCl C10H18ClN |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_51065 |
|
| has_exact_synonym |
Amantadine hydrochloride adamantan-1-aminium chloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-Aminoadamantene hydrochlorid 1-Adamantanamine hydrochloride tricyclo[3.3.1.1(3,7)]decan-1-aminium chloride 1-Aminoadamantane hydrochloride Symmetrel 1-Adamantylamine hydrochloride |
|
| id |
CHEBI:2619 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H17N.ClH/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;/h7-9H,1-6,11H2;1H |
|
| inchikey |
WOLHOYHSEKDWQH-UHFFFAOYSA-N |
|
| label |
amantadine hydrochloride |
|
| mass |
187.70936 |
|
| monoisotopicmass |
187.11278 |
|
| notation |
CHEBI:2619 |
|
| prefLabel |
amantadine hydrochloride |
|
| smiles |
[Cl-].[NH3+]C12CC3CC(CC(C3)C1)C2 |
|
| treeView | ||
| subClassOf |