loading...| Preferred Name |
methacrylic acid |
|
| Synonyms |
methacrylic acid 2-methylprop-2-enoic acid methylacrylic acid Methacrylsaeure 2-methylpropenoic acid 2-Methylpropensaeure 2-methylacrylic acid alpha-methacrylic acid alpha-methylacrylic acid 2-methylenepropionic acid Methakrylsaeure 2-methyl-2-propenoic acid |
|
| Definitions |
An alpha,beta-unsaturated monocarboxylic acid that is acrylic acid in which the hydrogen at position 2 is substituted by a methyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_25219 |
|
| charge |
0 |
|
| database_cross_reference |
Gmelin:49631 PMID:24227222 Beilstein:1719937 CAS:79-41-4 Wikipedia:Methacrylic_acid Reaxys:1719937 PMID:24398912 |
|
| definition |
An alpha,beta-unsaturated monocarboxylic acid that is acrylic acid in which the hydrogen at position 2 is substituted by a methyl group. |
|
| formula |
C4H6O2 |
|
| has functional parent | ||
| has_exact_synonym |
methacrylic acid 2-methylprop-2-enoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
methylacrylic acid Methacrylsaeure 2-methylpropenoic acid 2-Methylpropensaeure 2-methylacrylic acid alpha-methacrylic acid alpha-methylacrylic acid 2-methylenepropionic acid Methakrylsaeure 2-methyl-2-propenoic acid |
|
| id |
CHEBI:25219 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H6O2/c1-3(2)4(5)6/h1H2,2H3,(H,5,6) |
|
| inchikey |
CERQOIWHTDAKMF-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
methacrylic acid |
|
| mass |
86.08924 |
|
| monoisotopicmass |
86.03678 |
|
| notation |
CHEBI:25219 |
|
| prefLabel |
methacrylic acid |
|
| smiles |
CC(=C)C(O)=O |
|
| treeView | ||
| subClassOf |