Preferred Name |
acetophenazine |
|
Synonyms |
1-(10-{3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl}-10H-phenothiazin-2-yl)ethanone Acetophenazine |
|
Definitions |
A member of the class of phenothiazines that is 10H-phenothiazine substituted by a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the nitogen atom and an acetyl group at position 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2401 |
|
charge |
0 |
|
database_cross_reference |
KEGG:C06807 Wikipedia:Acetophenazine Drug_Central:59 DrugBank:DB01063 HMDB:HMDB0015196 PMID:14020672 PMID:13904111 CAS:2751-68-0 PMID:13986480 PMID:14211419 Reaxys:57631 Beilstein:57631 |
|
definition |
A member of the class of phenothiazines that is 10H-phenothiazine substituted by a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the nitogen atom and an acetyl group at position 2. |
|
formula |
C23H29N3O2S |
|
has functional parent | ||
has role | ||
has_exact_synonym |
1-(10-{3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl}-10H-phenothiazin-2-yl)ethanone Acetophenazine |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:2401 |
|
in_subset | ||
inchi |
InChI=1S/C23H29N3O2S/c1-18(28)19-7-8-23-21(17-19)26(20-5-2-3-6-22(20)29-23)10-4-9-24-11-13-25(14-12-24)15-16-27/h2-3,5-8,17,27H,4,9-16H2,1H3 |
|
inchikey |
WNTYBHLDCKXEOT-UHFFFAOYSA-N |
|
label |
acetophenazine |
|
mass |
411.56138 |
|
monoisotopicmass |
411.19805 |
|
notation |
CHEBI:2401 |
|
prefLabel |
acetophenazine |
|
smiles |
CC(=O)c1ccc2Sc3ccccc3N(CCCN3CCN(CCO)CC3)c2c1 |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_46845 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_46845 |