loading...| Preferred Name |
citrulline |
|
| Synonyms |
2-amino-5-(carbamoylamino)pentanoic acid N(5)-carbamoylornithine citrulline Citrulline dl-citrulline Citrullin 2-Amino-5-uredovaleric acid Cit N(5)-carbamoyl-DL-ornithine citrulina N(5)-(aminocarbonyl)-DL-ornithine DL-2-amino-5-ureidovaleric acid N(5)-(aminocarbonyl)ornithine |
|
| Definitions |
The parent compound of the citrulline class consisting of ornithine having a carbamoyl group at the N(5)-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18211 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:18989563 Beilstein:1725417 PMID:21129371 PMID:21482070 PMID:1378088 PMID:11696417 PMID:17558653 CAS:627-77-0 Wikipedia:Citrulline PMID:11094453 PMID:18437289 PMID:18440672 PMID:17513438 Reaxys:1725417 Beilstein:2328251 PMID:19144577 PMID:17693747 PMID:17005970 PMID:11113071 PMID:16082501 PMID:16708633 |
|
| definition |
The parent compound of the citrulline class consisting of ornithine having a carbamoyl group at the N(5)-position. |
|
| formula |
C6H13N3O3 |
|
| has role | ||
| has_alternative_id |
CHEBI:3730 CHEBI:14002 |
|
| has_exact_synonym |
2-amino-5-(carbamoylamino)pentanoic acid N(5)-carbamoylornithine citrulline Citrulline |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dl-citrulline Citrullin 2-Amino-5-uredovaleric acid Cit N(5)-carbamoyl-DL-ornithine citrulina N(5)-(aminocarbonyl)-DL-ornithine DL-2-amino-5-ureidovaleric acid N(5)-(aminocarbonyl)ornithine |
|
| id |
CHEBI:18211 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12) |
|
| inchikey |
RHGKLRLOHDJJDR-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
citrulline |
|
| mass |
175.18584 |
|
| monoisotopicmass |
175.09569 |
|
| notation |
CHEBI:18211 |
|
| prefLabel |
citrulline |
|
| smiles |
NC(CCCNC(N)=O)C(O)=O |
|
| treeView | ||
| subClassOf |