loading...| Preferred Name |
fumaric acid |
|
| Synonyms |
FUMARIC ACID (2E)-but-2-enedioic acid Fumaric acid trans-1,2-ethylenedicarboxylic acid (2E)-2-butenedioic acid trans-ethene-1,2-dioic acid trans-but-2-enedioic acid Fumarsaeure trans-Butenedioic acid E297 (E)-2-butenedioic acid |
|
| Definitions |
A butenedioic acid in which the C=C double bond has E geometry. It is an intermediate metabolite in the citric acid cycle. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18012 |
|
| charge |
0 |
|
| database_cross_reference |
PDBeChem:FUM MetaCyc:FUM HMDB:HMDB0000134 PMID:21414846 PPDB:1347 PMID:22113915 Gmelin:49855 PMID:17439666 PMID:22217732 FooDB:FDB003291 CAS:110-17-8 Wikipedia:Fumaric_Acid PMID:22516248 Beilstein:605763 Reaxys:605763 Drug_Central:3229 PMID:23472183 KNApSAcK:C00001183 KEGG:D02308 KEGG:C00122 DrugBank:DB01677 |
|
| definition |
A butenedioic acid in which the C=C double bond has E geometry. It is an intermediate metabolite in the citric acid cycle. |
|
| formula |
C4H4O4 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_176497 |
|
| has_alternative_id |
CHEBI:24124 CHEBI:5190 CHEBI:42743 |
|
| has_exact_synonym |
FUMARIC ACID (2E)-but-2-enedioic acid Fumaric acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
trans-1,2-ethylenedicarboxylic acid (2E)-2-butenedioic acid trans-ethene-1,2-dioic acid trans-but-2-enedioic acid Fumarsaeure trans-Butenedioic acid E297 (E)-2-butenedioic acid |
|
| id |
CHEBI:18012 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ |
|
| inchikey |
VZCYOOQTPOCHFL-OWOJBTEDSA-N |
|
| is conjugate acid of | ||
| label |
fumaric acid |
|
| mass |
116.07220 |
|
| monoisotopicmass |
116.01096 |
|
| notation |
CHEBI:18012 |
|
| prefLabel |
fumaric acid |
|
| smiles |
OC(=O)\C=C\C(O)=O |
|
| treeView | ||
| subClassOf |