Preferred Name |
inosine |
|
Synonyms |
INOSINE 9-(beta-D-ribofuranosyl)-9H-purin-6-ol (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-hydroxy-9H-purin-9-yl)tetrahydrofuran-3,4-diol Inosine inosine hypoxanthine D-riboside Inosin 9-beta-D-ribofuranosylhypoxanthine 9-beta-D-ribofuranosyl-9H-purin-6-ol inosina hypoxanthosine inosinum i |
|
Definitions |
A purine nucleoside in which hypoxanthine is attached to ribofuranose via a beta-N(9)-glycosidic bond. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17596 |
|
charge |
0 |
|
database_cross_reference |
KNApSAcK:C00019692 Gmelin:489332 KEGG:C00294 Wikipedia:Inosine PMID:22770225 Beilstein:624889 Reaxys:624889 MetaCyc:INOSINE KEGG:D00054 Drug_Central:3301 ECMDB:ECMDB00195 CAS:58-63-9 HMDB:HMDB0000195 YMDB:YMDB00510 PDBeChem:NOS |
|
definition |
A purine nucleoside in which hypoxanthine is attached to ribofuranose via a beta-N(9)-glycosidic bond. |
|
formula |
C10H12N4O5 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
has_alternative_id |
CHEBI:24841 CHEBI:14456 CHEBI:5927 CHEBI:44407 |
|
has_exact_synonym |
INOSINE 9-(beta-D-ribofuranosyl)-9H-purin-6-ol (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-hydroxy-9H-purin-9-yl)tetrahydrofuran-3,4-diol Inosine inosine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
hypoxanthine D-riboside Inosin 9-beta-D-ribofuranosylhypoxanthine 9-beta-D-ribofuranosyl-9H-purin-6-ol inosina hypoxanthosine inosine inosinum i |
|
id |
CHEBI:17596 |
|
in_subset | ||
inchi |
InChI=1S/C10H12N4O5/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18/h2-4,6-7,10,15-17H,1H2,(H,11,12,18)/t4-,6-,7-,10-/m1/s1 |
|
inchikey |
UGQMRVRMYYASKQ-KQYNXXCUSA-N |
|
label |
inosine |
|
mass |
268.22610 |
|
monoisotopicmass |
268.08077 |
|
notation |
CHEBI:17596 |
|
prefLabel |
inosine |
|
smiles |
OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cnc2c(O)ncnc12 |
|
treeView | ||
subClassOf |