loading...| Preferred Name |
5'-S-methyl-5'-thioadenosine |
|
| Synonyms |
5'-deoxy-5'-(methylsulfanyl)adenosine MTA Thiomethyladenosine 5'-Methylthioadenosine 9-(5-S-methyl-5-thio-beta-D-ribofuranosyl)-9H-purin-6-amine S-methyl-5'-thioadenosine Methylthioadenosine 5-Methylthioadenosine 5'-Deoxy-5'-(methylthio)adenosine S-Methyl-5'-thioadenosine |
|
| Definitions |
Adenosine with the hydroxy group at C-5' substituted with a methylthio (methylsulfanyl) group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17509 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB02282 Beilstein:42420 KEGG:C00170 HMDB:HMDB0001173 PMID:22735334 MetaCyc:5-METHYLTHIOADENOSINE Reaxys:42420 CAS:2457-80-9 |
|
| definition |
Adenosine with the hydroxy group at C-5' substituted with a methylthio (methylsulfanyl) group. |
|
| formula |
C11H15N5O3S |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
| has_alternative_id |
CHEBI:12055 CHEBI:20494 CHEBI:12771 CHEBI:1966 CHEBI:12064 CHEBI:14605 CHEBI:1986 CHEBI:20491 CHEBI:44181 |
|
| has_exact_synonym |
5'-deoxy-5'-(methylsulfanyl)adenosine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
MTA Thiomethyladenosine 5'-Methylthioadenosine 9-(5-S-methyl-5-thio-beta-D-ribofuranosyl)-9H-purin-6-amine S-methyl-5'-thioadenosine Methylthioadenosine 5-Methylthioadenosine 5'-Deoxy-5'-(methylthio)adenosine S-Methyl-5'-thioadenosine |
|
| id |
CHEBI:17509 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H15N5O3S/c1-20-2-5-7(17)8(18)11(19-5)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7-,8-,11-/m1/s1 |
|
| inchikey |
WUUGFSXJNOTRMR-IOSLPCCCSA-N |
|
| label |
5'-S-methyl-5'-thioadenosine |
|
| mass |
297.33470 |
|
| monoisotopicmass |
297.08956 |
|
| notation |
CHEBI:17509 |
|
| prefLabel |
5'-S-methyl-5'-thioadenosine |
|
| smiles |
CSC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cnc2c(N)ncnc12 |
|
| treeView | ||
| subClassOf |