Preferred Name |
carnitine |
|
Synonyms |
carnitine 3-hydroxy-4-(trimethylammonio)butanoate D,L-carnitine |
|
Definitions |
An amino-acid betaine that is butanoate substituted with a hydroxy group at position C-3 and a trimethylammonium group at C-4. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17126 |
|
charge |
0 |
|
database_cross_reference |
PMID:23868375 PMID:22770225 CAS:461-06-3 KEGG:C00487 Wikipedia:Carnitine Patent:US4255449 DrugBank:DB02648 Reaxys:1866665 Beilstein:1866665 MetaCyc:DL-CARNITINE Patent:US4315944 |
|
definition |
An amino-acid betaine that is butanoate substituted with a hydroxy group at position C-3 and a trimethylammonium group at C-4. |
|
formula |
C7H15NO3 |
|
has functional parent | ||
has role | ||
has_alternative_id |
CHEBI:23038 CHEBI:20047 CHEBI:13947 CHEBI:11817 |
|
has_exact_synonym |
carnitine 3-hydroxy-4-(trimethylammonio)butanoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
D,L-carnitine |
|
id |
CHEBI:17126 |
|
in_subset | ||
inchi |
InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3 |
|
inchikey |
PHIQHXFUZVPYII-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
carnitine |
|
mass |
161.19894 |
|
monoisotopicmass |
161.10519 |
|
notation |
CHEBI:17126 |
|
prefLabel |
carnitine |
|
smiles |
C[N+](C)(C)CC(O)CC([O-])=O |
|
treeView | ||
subClassOf |