loading...| Preferred Name |
lanosterol |
|
| Synonyms |
LANOSTEROL lanosterol lanosta-8,24-dien-3beta-ol Lanosterol 4,4',14alpha-Trimethyl-5alpha-cholesta-8,24-dien-3beta-ol (3beta,5alpha)-4,4,14-trimethylcholesta-8,24-dien-3-ol (3beta)-lanosta-8,24-dien-3-ol Lanosterin |
|
| Definitions |
A tetracyclic triterpenoid that is lanosta-8,24-diene substituted by a beta-hydroxy group at the 3beta position. It is the compound from which all steroids are derived. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16521 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB03696 PMID:22988818 KEGG:C01724 PMID:16445886 Reaxys:2226449 PMID:22824432 PMID:14660793 Beilstein:2226449 HMDB:HMDB0001251 Wikipedia:Lanosterol PMID:26200341 LIPID_MAPS_instance:LMST01010017 KNApSAcK:C00003657 CAS:79-63-0 PMID:22933236 PMID:21818119 PMID:24525128 PMID:21838962 PDBeChem:LAN PMID:26069216 MetaCyc:LANOSTEROL |
|
| definition |
A tetracyclic triterpenoid that is lanosta-8,24-diene substituted by a beta-hydroxy group at the 3beta position. It is the compound from which all steroids are derived. |
|
| formula |
C30H50O |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
| has_alternative_id |
CHEBI:6374 CHEBI:25011 CHEBI:43584 CHEBI:14500 |
|
| has_exact_synonym |
LANOSTEROL lanosterol lanosta-8,24-dien-3beta-ol Lanosterol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4,4',14alpha-Trimethyl-5alpha-cholesta-8,24-dien-3beta-ol (3beta,5alpha)-4,4,14-trimethylcholesta-8,24-dien-3-ol (3beta)-lanosta-8,24-dien-3-ol Lanosterin |
|
| id |
CHEBI:16521 |
|
| in_subset | ||
| inchi |
InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2,1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1 |
|
| inchikey |
CAHGCLMLTWQZNJ-BQNIITSRSA-N |
|
| label |
lanosterol |
|
| mass |
426.729 |
|
| monoisotopicmass |
426.38617 |
|
| notation |
CHEBI:16521 |
|
| prefLabel |
lanosterol |
|
| smiles |
[H][C@@]1(CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@]1([H])CC3)[C@H](C)CCC=C(C)C |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_138029 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_138029 |