Preferred Name |
1,4-benzoquinone |
|
Synonyms |
cyclohexa-2,5-diene-1,4-dione 1,4-Benzoquinone 1,4-benzoquinone p-Chinon Quinone 1,4-Benzochinon p-quinone para-benzoquinone p-Benzoquinone benzo-1,4-quinone 2,5-Cyclohexadiene-1,4-dione benzoquinone |
|
Definitions |
The simplest member of the class of 1,4-benzoquinones, obtained by the formal oxidation of hydroquinone to the corresponding diketone. It is a metabolite of benzene. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16509 |
|
charge |
0 |
|
database_cross_reference |
PMID:24023812 PMID:1395635 PMID:15182198 UM-BBD_compID:c0261 PMID:10462055 MetaCyc:P-BENZOQUINONE PDBeChem:PLQ PMID:15920754 Wikipedia:1,4-Benzoquinone PMID:15618234 Beilstein:773967 CAS:106-51-4 KEGG:C15602 PMID:9118901 Reaxys:773967 PMID:16484134 HMDB:HMDB0003364 Gmelin:2741 PMID:25057895 KEGG:C00472 PMID:11304127 |
|
definition |
The simplest member of the class of 1,4-benzoquinones, obtained by the formal oxidation of hydroquinone to the corresponding diketone. It is a metabolite of benzene. |
|
formula |
C6H4O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_75771 |
|
has_alternative_id |
CHEBI:18927 CHEBI:49820 CHEBI:15009 CHEBI:8730 CHEBI:12837 |
|
has_exact_synonym |
cyclohexa-2,5-diene-1,4-dione 1,4-Benzoquinone 1,4-benzoquinone |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
p-Chinon Quinone 1,4-Benzochinon p-quinone para-benzoquinone p-Benzoquinone benzo-1,4-quinone 2,5-Cyclohexadiene-1,4-dione benzoquinone |
|
id |
CHEBI:16509 |
|
in_subset | ||
inchi |
InChI=1S/C6H4O2/c7-5-1-2-6(8)4-3-5/h1-4H |
|
inchikey |
AZQWKYJCGOJGHM-UHFFFAOYSA-N |
|
label |
1,4-benzoquinone |
|
mass |
108.09480 |
|
monoisotopicmass |
108.02113 |
|
notation |
CHEBI:16509 |
|
prefLabel |
1,4-benzoquinone |
|
smiles |
O=C1C=CC(=O)C=C1 |
|
treeView | ||
subClassOf |