Preferred Name |
pyrogallol |
|
Synonyms |
benzene-1,2,3-triol Pyrogallol 1,2,3-trihydroxybenzene 1,2,3-Benzenetriol 1,2,3-Trihydroxybenzene Pyrogallic acid |
|
Definitions |
A benzenetriol carrying hydroxy groups at positions 1, 2 and 3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16164 |
|
charge |
0 |
|
database_cross_reference |
PMID:24415452 PMID:24458986 Reaxys:907431 PMID:10427737 MetaCyc:PYROGALLOL CAS:87-66-1 PMID:19948158 KNApSAcK:C00002670 UM-BBD_compID:c0025 HMDB:HMDB0013674 PMID:18506365 KEGG:C01108 PMID:18760383 Wikipedia:Pyrogallol |
|
definition |
A benzenetriol carrying hydroxy groups at positions 1, 2 and 3. |
|
formula |
C6H6O3 |
|
has role | ||
has_alternative_id |
CHEBI:11135 CHEBI:14985 CHEBI:45264 CHEBI:482 CHEBI:22708 |
|
has_exact_synonym |
benzene-1,2,3-triol Pyrogallol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1,2,3-trihydroxybenzene 1,2,3-Benzenetriol benzene-1,2,3-triol 1,2,3-Trihydroxybenzene Pyrogallic acid |
|
id |
CHEBI:16164 |
|
in_subset | ||
inchi |
InChI=1S/C6H6O3/c7-4-2-1-3-5(8)6(4)9/h1-3,7-9H |
|
inchikey |
WQGWDDDVZFFDIG-UHFFFAOYSA-N |
|
label |
pyrogallol |
|
mass |
126.11004 |
|
monoisotopicmass |
126.03169 |
|
notation |
CHEBI:16164 |
|
prefLabel |
pyrogallol |
|
smiles |
Oc1cccc(O)c1O |
|
treeView | ||
subClassOf |