loading...| Preferred Name |
dihydroxyacetone |
|
| Synonyms |
dihydroxyacetone Dihydroxyacetone DIHYDROXYACETONE 1,3-dihydroxypropan-2-one Bis(hydroxymethyl) ketone 1,3-Dihydroxypropanone 1,3-Dihydroxy-2-propanone 1,3-propanediol-2-one DHA alpha,alpha'-dihydroxyacetone 1,3-Dihydroxyacetone 1,3-Dihydroxypropan-2-one 1,3-Dihydroxydimethyl ketone Glycerone |
|
| Definitions |
A ketotriose consisting of acetone bearing hydroxy substituents at positions 1 and 3. The simplest member of the class of ketoses and the parent of the class of glycerones. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16016 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:1740268 HMDB:HMDB0001882 Wikipedia:Dihydroxyacetone PDBeChem:2HA PMID:21598406 PMID:24209782 Beilstein:1740268 PMID:23554234 PMID:23748086 PMID:21549029 KEGG:C00184 MetaCyc:DIHYDROXYACETONE CAS:96-26-4 KEGG:D07841 DrugBank:DB01775 PMID:20936361 PMID:23543734 |
|
| definition |
A ketotriose consisting of acetone bearing hydroxy substituents at positions 1 and 3. The simplest member of the class of ketoses and the parent of the class of glycerones. |
|
| formula |
C3H6O3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_25212 |
|
| has_alternative_id |
CHEBI:24354 CHEBI:39809 CHEBI:5453 CHEBI:14340 |
|
| has_exact_synonym |
dihydroxyacetone Dihydroxyacetone DIHYDROXYACETONE 1,3-dihydroxypropan-2-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Bis(hydroxymethyl) ketone 1,3-Dihydroxypropanone 1,3-Dihydroxy-2-propanone 1,3-propanediol-2-one DHA alpha,alpha'-dihydroxyacetone 1,3-Dihydroxyacetone 1,3-Dihydroxypropan-2-one 1,3-Dihydroxydimethyl ketone Glycerone |
|
| id |
CHEBI:16016 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H6O3/c4-1-3(6)2-5/h4-5H,1-2H2 |
|
| inchikey |
RXKJFZQQPQGTFL-UHFFFAOYSA-N |
|
| label |
dihydroxyacetone |
|
| mass |
90.078 |
|
| monoisotopicmass |
90.03169 |
|
| notation |
CHEBI:16016 |
|
| prefLabel |
dihydroxyacetone |
|
| smiles |
C(CO)(CO)=O |
|
| treeView | ||
| subClassOf |