loading...| Preferred Name |
(-)-methyl jasmonate |
|
| Synonyms |
(-)-Methyl jasmonate methyl {(1R,2R)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetate 3-oxo-2-(2-pentenyl)cyclopentaneacetic acid methyl ester methyl (-)-jasmonate Methyl jasmonate |
|
| Definitions |
A jasmonate ester that is the methyl ester of jasmonic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15929 |
|
| charge |
0 |
|
| database_cross_reference |
MetaCyc:CPD1F-2 HMDB:HMDB0036583 KEGG:C11512 Reaxys:4232548 PMID:17043086 KNApSAcK:C00000219 CAS:1211-29-6 PMID:18038760 Wikipedia:Methyl_jasmonate LIPID_MAPS_instance:LMFA02020010 PMID:24497113 |
|
| definition |
A jasmonate ester that is the methyl ester of jasmonic acid. |
|
| formula |
C13H20O3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| has_alternative_id |
CHEBI:14602 CHEBI:25243 CHEBI:6879 |
|
| has_exact_synonym |
(-)-Methyl jasmonate methyl {(1R,2R)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-oxo-2-(2-pentenyl)cyclopentaneacetic acid methyl ester methyl (-)-jasmonate Methyl jasmonate |
|
| id |
CHEBI:15929 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H20O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h4-5,10-11H,3,6-9H2,1-2H3/b5-4-/t10-,11-/m1/s1 |
|
| inchikey |
GEWDNTWNSAZUDX-WQMVXFAESA-N |
|
| label |
(-)-methyl jasmonate |
|
| mass |
224.29610 |
|
| monoisotopicmass |
224.14124 |
|
| notation |
CHEBI:15929 |
|
| prefLabel |
(-)-methyl jasmonate |
|
| smiles |
CC\C=C/C[C@@H]1[C@@H](CC(=O)OC)CCC1=O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_52464 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_52464 |