loading...| Preferred Name |
(+)-catechin |
|
| Synonyms |
(+)-Catechin (2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-1H-chromene-3,5,7-triol Cianidanol (+)-(2R,3S)-5,7,3',4'-Tetrahydroxyflavan-3-ol (2R-trans)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-1-Benzopyran-3,5,7-triol (2R,3S)-2-(3,4-dihydroxyphenyl)chromane-3,5,7-triol D-Catechin Cyanidanol (+)-3',4',5,7-Tetrahydroxy-2,3-trans-flavan-3-ol (2R,3S)-catechin (2R,3S)-Catechin catechuic acid (2R,3S)-(+)-Catechin (+)-Cyanidan-3-ol (+)-Catechol |
|
| Definitions |
The (+)-enantiomer of catechin and a polyphenolic antioxidant plant metabolite. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15600 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:10617953 KEGG:C06562 PMID:9438556 PDBeChem:KXN Reaxys:92761 CAS:154-23-4 LIPID_MAPS_instance:LMPK12020001 KNApSAcK:C00000947 Drug_Central:629 PMID:1502708 PMID:8224433 HMDB:HMDB0002780 MetaCyc:CPD-1961 Wikipedia:Catechin PMID:11196148 |
|
| definition |
The (+)-enantiomer of catechin and a polyphenolic antioxidant plant metabolite. |
|
| formula |
C15H14O6 |
|
| has role | ||
| has_alternative_id |
CHEBI:18 CHEBI:18443 CHEBI:10862 |
|
| has_exact_synonym |
(+)-Catechin (2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-1H-chromene-3,5,7-triol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Cianidanol (+)-(2R,3S)-5,7,3',4'-Tetrahydroxyflavan-3-ol (2R-trans)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-1-Benzopyran-3,5,7-triol (2R,3S)-2-(3,4-dihydroxyphenyl)chromane-3,5,7-triol D-Catechin Cyanidanol (+)-3',4',5,7-Tetrahydroxy-2,3-trans-flavan-3-ol (2R,3S)-catechin (2R,3S)-Catechin catechuic acid (2R,3S)-(+)-Catechin (+)-Cyanidan-3-ol (+)-Catechol |
|
| id |
CHEBI:15600 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m0/s1 |
|
| inchikey |
PFTAWBLQPZVEMU-DZGCQCFKSA-N |
|
| is enantiomer of | ||
| label |
(+)-catechin |
|
| mass |
290.26810 |
|
| monoisotopicmass |
290.07904 |
|
| notation |
CHEBI:15600 |
|
| prefLabel |
(+)-catechin |
|
| smiles |
O[C@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1 |
|
| treeView | ||
| subClassOf |