loading...| Preferred Name |
benzocaine |
|
| Synonyms |
ethyl 4-aminobenzoate p-Ethoxycarboxylic aniline Benzocaina p-Carbethoxyaniline Benzocaine 4-aminobenzoic acid ethyl ester Ethyl p-aminobenzoate p-(Ethoxycarbonyl)aniline Amben ethyl ester Ethyl p-aminophenylcarboxylate Benzocainum Ethyl aminobenzoate |
|
| Definitions |
A benzoate ester having 4-aminobenzoic acid as the acid component and ethanol as the alcohol component. A surface anaesthetic, it is used to suppress the gag reflex, and as a lubricant and topical anaesthetic on the larynx, mouth, nasal cavity, respiratory tract, oesophagus, rectum, urinary tract, and vagina. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_116735 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:323 PMID:2579237 PMID:22015737 PMID:12873507 PMID:23565580 PMID:18971079 PMID:29079364 Reaxys:638434 PMID:21616561 PMID:25097477 Beilstein:638434 KEGG:D00552 PMID:22551703 PMID:23696166 PMID:22556388 PMID:16640711 LINCS:LSM-5830 DrugBank:DB01086 HMDB:HMDB0004992 PMID:23301559 PMID:22105694 PMID:1155304 PMID:12574744 PMID:10866370 CAS:94-09-7 Wikipedia:Benzocaine KEGG:C07527 |
|
| definition |
A benzoate ester having 4-aminobenzoic acid as the acid component and ethanol as the alcohol component. A surface anaesthetic, it is used to suppress the gag reflex, and as a lubricant and topical anaesthetic on the larynx, mouth, nasal cavity, respiratory tract, oesophagus, rectum, urinary tract, and vagina. |
|
| formula |
C9H11NO2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_50904 http://purl.obolibrary.org/obo/CHEBI_48425 |
|
| has_alternative_id |
CHEBI:3030 |
|
| has_exact_synonym |
ethyl 4-aminobenzoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
p-Ethoxycarboxylic aniline Benzocaina p-Carbethoxyaniline Benzocaine 4-aminobenzoic acid ethyl ester Ethyl p-aminobenzoate p-(Ethoxycarbonyl)aniline Amben ethyl ester Ethyl p-aminophenylcarboxylate Benzocainum Ethyl aminobenzoate |
|
| id |
CHEBI:116735 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
|
| inchikey |
BLFLLBZGZJTVJG-UHFFFAOYSA-N |
|
| label |
benzocaine |
|
| mass |
165.18910 |
|
| monoisotopicmass |
165.07898 |
|
| notation |
CHEBI:116735 |
|
| prefLabel |
benzocaine |
|
| smiles |
CCOC(=O)c1ccc(N)cc1 |
|
| treeView | ||
| subClassOf |