Preferred Name |
zidovudine |
|
Synonyms |
3'-azido-3'-deoxythymidine AZT zidovudine Zidovudinum Retrovir Azidothymidine Zidovudin |
|
Definitions |
A pyrimidine 2',3'-dideoxyribonucleoside compound having a 3'-azido substituent and thymine as the nucleobase. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_10110 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB00495 PDBeChem:AZZ LINCS:LSM-5806 KEGG:D00413 PMID:19112024 KEGG:C07210 Wikipedia:Zidovudine MetaCyc:CPD-15110 Patent:US4724232 PMID:9203666 CAS:30516-87-1 Beilstein:763034 PMID:26859826 Drug_Central:2861 PMID:29438107 |
|
definition |
A pyrimidine 2',3'-dideoxyribonucleoside compound having a 3'-azido substituent and thymine as the nucleobase. |
|
formula |
C10H13N5O4 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_53756 |
|
has_alternative_id |
CHEBI:619601 |
|
has_exact_synonym |
3'-azido-3'-deoxythymidine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
AZT zidovudine Zidovudinum Retrovir Azidothymidine Zidovudin |
|
id |
CHEBI:10110 |
|
in_subset | ||
inchi |
InChI=1S/C10H13N5O4/c1-5-3-15(10(18)12-9(5)17)8-2-6(13-14-11)7(4-16)19-8/h3,6-8,16H,2,4H2,1H3,(H,12,17,18)/t6-,7+,8+/m0/s1 |
|
inchikey |
HBOMLICNUCNMMY-XLPZGREQSA-N |
|
label |
zidovudine |
|
mass |
267.24130 |
|
monoisotopicmass |
267.09675 |
|
notation |
CHEBI:10110 |
|
prefLabel |
zidovudine |
|
smiles |
Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)c(=O)[nH]c1=O |
|
treeView | ||
subClassOf |