loading...| Preferred Name |
zalcitabine |
|
| Synonyms |
2',3'-dideoxycytidine zalcitabine DDCYD 4-amino-1-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidin-2(1H)-one DDC Dideoxycytidine 2',3'-Dideoxycytidine |
|
| Definitions |
A pyrimidine 2',3'-dideoxyribonucleoside compound having cytosine as the nucleobase. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_10101 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:654956 Reaxys:654956 KEGG:C07207 Wikipedia:Zalcitabine CAS:7481-89-2 PMID:11905988 KEGG:D00412 HMDB:HMDB0015078 DrugBank:DB00943 Drug_Central:2856 LINCS:LSM-5915 PMID:7727578 |
|
| definition |
A pyrimidine 2',3'-dideoxyribonucleoside compound having cytosine as the nucleobase. |
|
| formula |
C9H13N3O3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_53756 |
|
| has_exact_synonym |
2',3'-dideoxycytidine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
zalcitabine DDCYD 4-amino-1-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidin-2(1H)-one DDC Dideoxycytidine 2',3'-Dideoxycytidine |
|
| id |
CHEBI:10101 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H13N3O3/c10-7-3-4-12(9(14)11-7)8-2-1-6(5-13)15-8/h3-4,6,8,13H,1-2,5H2,(H2,10,11,14)/t6-,8+/m0/s1 |
|
| inchikey |
WREGKURFCTUGRC-POYBYMJQSA-N |
|
| label |
zalcitabine |
|
| mass |
211.21780 |
|
| monoisotopicmass |
211.09569 |
|
| notation |
CHEBI:10101 |
|
| prefLabel |
zalcitabine |
|
| smiles |
Nc1ccn([C@H]2CC[C@@H](CO)O2)c(=O)n1 |
|
| treeView | ||
| subClassOf |