Preferred Name |
zalcitabine |
|
Synonyms |
2',3'-dideoxycytidine zalcitabine DDCYD 4-amino-1-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidin-2(1H)-one DDC Dideoxycytidine 2',3'-Dideoxycytidine |
|
Definitions |
A pyrimidine 2',3'-dideoxyribonucleoside compound having cytosine as the nucleobase. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_10101 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:654956 Reaxys:654956 KEGG:C07207 Wikipedia:Zalcitabine CAS:7481-89-2 PMID:11905988 KEGG:D00412 HMDB:HMDB0015078 DrugBank:DB00943 Drug_Central:2856 LINCS:LSM-5915 PMID:7727578 |
|
definition |
A pyrimidine 2',3'-dideoxyribonucleoside compound having cytosine as the nucleobase. |
|
formula |
C9H13N3O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_53756 |
|
has_exact_synonym |
2',3'-dideoxycytidine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
zalcitabine DDCYD 4-amino-1-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidin-2(1H)-one DDC Dideoxycytidine 2',3'-Dideoxycytidine |
|
id |
CHEBI:10101 |
|
in_subset | ||
inchi |
InChI=1S/C9H13N3O3/c10-7-3-4-12(9(14)11-7)8-2-1-6(5-13)15-8/h3-4,6,8,13H,1-2,5H2,(H2,10,11,14)/t6-,8+/m0/s1 |
|
inchikey |
WREGKURFCTUGRC-POYBYMJQSA-N |
|
label |
zalcitabine |
|
mass |
211.21780 |
|
monoisotopicmass |
211.09569 |
|
notation |
CHEBI:10101 |
|
prefLabel |
zalcitabine |
|
smiles |
Nc1ccn([C@H]2CC[C@@H](CO)O2)c(=O)n1 |
|
treeView | ||
subClassOf |