Preferred Name |
|
|
Synonyms |
Pioglitazone 5-{4-[2-(5-ethylpyridin-2-yl)ethoxy]benzyl}-1,3-thiazolidine-2,4-dione pioglitazona pioglitazone pioglitazonum (+-)-5-((4-(2-(5-ethyl-2-pyridinyl)ethoxy)phenyl)methyl)-2,4-thiazolidinedione |
|
Definitions |
A member of the class of thiazolidenediones that is 1,3-thiazolidine-2,4-dione substituted by a benzyl group at position 5 which in turn is substituted by a 2-(5-ethylpyridin-2-yl)ethoxy group at position 4 of the phenyl ring. It exhibits hypoglycemic activity. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8228 |
|
charge |
0 |
|
database_cross_reference |
SNOMEDCT:326058001 NCIt:C71633 SNOMEDCT:395828009 MeSH:C060836 Wikipedia:Pioglitazone PMID:33798599 Beilstein:3595485 Patent:US4687777 Reaxys:3595485 PMID:14522601 HMDB:HMDB0015264 Patent:EP193256 PMID:33983968 PMID:27842070 LINCS:LSM-1592 KEGG:D08378 KEGG:C07675 PMID:17628757 Chemspider:4663 PMID:33995271 PMID:34006325 PMID:12879407 PMID:20797618 DrugBank:DB01132 Drug_Central:2179 PMID:33864097 PMID:18215232 CAS:111025-46-8 PMID:34009030 |
|
definition |
A member of the class of thiazolidenediones that is 1,3-thiazolidine-2,4-dione substituted by a benzyl group at position 5 which in turn is substituted by a 2-(5-ethylpyridin-2-yl)ethoxy group at position 4 of the phenyl ring. It exhibits hypoglycemic activity. |
|
formula |
C19H20N2O3S |
|
has_exact_synonym |
Pioglitazone 5-{4-[2-(5-ethylpyridin-2-yl)ethoxy]benzyl}-1,3-thiazolidine-2,4-dione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
pioglitazona pioglitazone pioglitazonum (+-)-5-((4-(2-(5-ethyl-2-pyridinyl)ethoxy)phenyl)methyl)-2,4-thiazolidinedione |
|
has_role | ||
id |
CHEBI:8228 |
|
in_subset | ||
inchi |
InChI=1S/C19H20N2O3S/c1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17/h3-8,12,17H,2,9-11H2,1H3,(H,21,22,23) |
|
inchikey |
HYAFETHFCAUJAY-UHFFFAOYSA-N |
|
label |
pioglitazone |
|
mass |
356.43978 |
|
monoisotopicmass |
356.11946 |
|
notation |
CHEBI:8228 |
|
smiles |
CCc1ccc(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc1 |
|
subClassOf |